bis(2-ethylhexyl) 2-diethoxyphosphorylbutanedioate structure
|
Common Name | bis(2-ethylhexyl) 2-diethoxyphosphorylbutanedioate | ||
|---|---|---|---|---|
| CAS Number | 78897-69-5 | Molecular Weight | 478.60000 | |
| Density | 1.019g/cm3 | Boiling Point | 535.6ºC at 760 mmHg | |
| Molecular Formula | C24H47O7P | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 290.7ºC | |
| Name | bis(2-ethylhexyl) 2-diethoxyphosphorylbutanedioate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.019g/cm3 |
|---|---|
| Boiling Point | 535.6ºC at 760 mmHg |
| Molecular Formula | C24H47O7P |
| Molecular Weight | 478.60000 |
| Flash Point | 290.7ºC |
| Exact Mass | 478.30600 |
| PSA | 97.94000 |
| LogP | 6.53040 |
| Index of Refraction | 1.453 |
| InChIKey | AFEXHLCFNWEGEY-UHFFFAOYSA-N |
| SMILES | CCCCC(CC)COC(=O)CC(C(=O)OCC(CC)CCCC)P(=O)(OCC)OCC |
|
~%
bis(2-ethylhexy... CAS#:78897-69-5 |
| Literature: Union Carbide and Carbon Corp. Patent: US2754319 , 1948 ; |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| Diaethoxyphosphoryl-bernsteinsaeure-bis-(2-aethyl-hexylester) |
| bis(2-ethylhexyl) 2-(diethoxyphosphoryl)butanedioate |
| diethoxyphosphoryl-succinic acid bis-(2-ethyl-hexyl ester) |