tert-butyldimethylsilyl glycidyl ether structure
|
Common Name | tert-butyldimethylsilyl glycidyl ether | ||
|---|---|---|---|---|
| CAS Number | 78906-15-7 | Molecular Weight | 188.33900 | |
| Density | 0.901 g/mL at 25ºC(lit.) | Boiling Point | 195-197ºC(lit.) | |
| Molecular Formula | C9H20O2Si | Melting Point | N/A | |
| MSDS | Chinese USA | Flash Point | 70ºC | |
| Name | tert-butyl-dimethyl-(oxiran-2-ylmethoxy)silane |
|---|---|
| Synonym | More Synonyms |
| Density | 0.901 g/mL at 25ºC(lit.) |
|---|---|
| Boiling Point | 195-197ºC(lit.) |
| Molecular Formula | C9H20O2Si |
| Molecular Weight | 188.33900 |
| Flash Point | 70ºC |
| Exact Mass | 188.12300 |
| PSA | 21.76000 |
| LogP | 2.40700 |
| Index of Refraction | n20/D 1.531(lit.) |
| InChIKey | YANSSVVGZPNSKD-UHFFFAOYSA-N |
| SMILES | CC(C)(C)[Si](C)(C)OCC1CO1 |
| Personal Protective Equipment | Eyeshields;Gloves;half-mask respirator (US);multi-purpose combination respirator cartridge (US) |
|---|
| Precursor 0 | |
|---|---|
| DownStream 1 | |
|
Practical access to highly enantioenriched C-3 building blocks via hydrolytic kinetic resolution. Furrow ME, et al.
J. Org. Chem. 63(20) , 6776-6777, (1998)
|
|
|
Synthesis of Glycidol-and Sugar-Derived Bicyclic ß-and ?/d-Amino Acids for Peptidomimetic Design. Danieli E, et al.
European J. Org. Chem. 2005(20) , 4372-4381, (2005)
|
| tert-butyl(dimethyl)(2-oxiranylmethoxy)silane |
| (rac)-(+/-)-2-(tert-butyldimethylsilyloxymethyl)oxirane |
| Oxirane,2-[[[(1,1-dimethylethyl)dimethylsilyl]oxy]methyl]-,(2S) |
| Oxirane,2-[[[(1,1-dimethylethyl)dimethylsilyl]oxy]methyl]-,(2R) |
| (+/-)-(tert-butyldimethylsilyl) glycidyl ether |