2-chloro-N-(2-oxochromen-3-yl)acetamide structure
|
Common Name | 2-chloro-N-(2-oxochromen-3-yl)acetamide | ||
|---|---|---|---|---|
| CAS Number | 78923-94-1 | Molecular Weight | 237.63900 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C11H8ClNO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 2-chloro-N-(2-oxochromen-3-yl)acetamide |
|---|
| Molecular Formula | C11H8ClNO3 |
|---|---|
| Molecular Weight | 237.63900 |
| Exact Mass | 237.01900 |
| PSA | 62.80000 |
| LogP | 2.61980 |
| InChIKey | VPOZFBFMRSTGOI-UHFFFAOYSA-N |
| SMILES | O=C(CCl)Nc1cc2ccccc2oc1=O |
|
~92%
2-chloro-N-(2-o... CAS#:78923-94-1 |
| Literature: Song, Hua-Can; Chen, Yi-Wen; Yao, Jun-Hua; Xu, Zun-Le; Bradshaw, Jerald S.; Savage, Paul B.; Izatt, Reed M. Journal of Heterocyclic Chemistry, 2003 , vol. 40, # 3 p. 475 - 479 |
|
~%
2-chloro-N-(2-o... CAS#:78923-94-1 |
| Literature: Song, Hua-Can; Chen, Yi-Wen; Yao, Jun-Hua; Xu, Zun-Le; Bradshaw, Jerald S.; Savage, Paul B.; Izatt, Reed M. Journal of Heterocyclic Chemistry, 2003 , vol. 40, # 3 p. 475 - 479 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |