1,1,2,2,3,3,4,4,5,5,6,6-dodecafluoro-7-(vinyloxy)heptane structure
|
Common Name | 1,1,2,2,3,3,4,4,5,5,6,6-dodecafluoro-7-(vinyloxy)heptane | ||
|---|---|---|---|---|
| CAS Number | 78971-81-0 | Molecular Weight | 358.12400 | |
| Density | 1.464g/cm3 | Boiling Point | 169.5ºC at 760 mmHg | |
| Molecular Formula | C9H6F12O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 62.5ºC | |
| Name | 7-ethenoxy-1,1,2,2,3,3,4,4,5,5,6,6-dodecafluoroheptane |
|---|---|
| Synonym | More Synonyms |
| Density | 1.464g/cm3 |
|---|---|
| Boiling Point | 169.5ºC at 760 mmHg |
| Molecular Formula | C9H6F12O |
| Molecular Weight | 358.12400 |
| Flash Point | 62.5ºC |
| Exact Mass | 358.02300 |
| PSA | 9.23000 |
| LogP | 4.58810 |
| Index of Refraction | 1.308 |
| InChIKey | PSLCNUISXILWOY-UHFFFAOYSA-N |
| SMILES | C=COCC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)F |
|
~51%
1,1,2,2,3,3,4,4... CAS#:78971-81-0 |
| Literature: Trofimov, B. A.; Khil'ko, M. Ya.; Nedolya, N. A.; Demanov, Yu. K.; Vyalykh, E. P. Journal of Organic Chemistry USSR (English Translation), 1982 , vol. 18, p. 647 - 651 Zhurnal Organicheskoi Khimii, 1982 , vol. 18, # 4 p. 744 - 749 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| EINECS 279-021-4 |
| 2,2,3,3,4,4,5,5,6,6,7,7-decafluoroheptyl vinyl ether |