4-Ethyl-I+/-,2-dihydroxybenzeneacetic acid
Modify Date: 2025-10-20 20:10:17
4-Ethyl-I+/-,2-dihydroxybenzeneacetic acid structure
|
Common Name | 4-Ethyl-I+/-,2-dihydroxybenzeneacetic acid | ||
|---|---|---|---|---|
| CAS Number | 78989-56-7 | Molecular Weight | 196.20 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C10H12O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 4-Ethyl-I+/-,2-dihydroxybenzeneacetic acid |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C10H12O4 |
|---|---|
| Molecular Weight | 196.20 |
| InChIKey | SHICEABVTBDWCE-UHFFFAOYSA-N |
| SMILES | CCc1ccc(C(O)C(=O)O)c(O)c1 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the molecular formula of 4-Ethyl-I+/-,2-dihydroxybenzeneacetic acid? |
| A: Molecular formula of 4-Ethyl-I+/-,2-dihydroxybenzeneacetic acid is C10H12O4. |
| Q: What is the molecular weight of 4-Ethyl-I+/-,2-dihydroxybenzeneacetic acid? |
| A: Molecular weight of 4-Ethyl-I+/-,2-dihydroxybenzeneacetic acid is 196.20. |
| Q: What is the Chinese name of 78989-56-7? |
| A: Chinese name of 78989-56-7 is 78989-56-7. |
| Q: What is the English name of 4-Ethyl-I+/-,2-dihydroxybenzeneacetic acid? |
| A: The English name of 4-Ethyl-I+/-,2-dihydroxybenzeneacetic acid is 4-Ethyl-I+/-,2-dihydroxybenzeneacetic acid. |
| Q: What is the InChIKey of 4-Ethyl-I+/-,2-dihydroxybenzeneacetic acid? |
| A: InChIKey of 4-Ethyl-I+/-,2-dihydroxybenzeneacetic acid is SHICEABVTBDWCE-UHFFFAOYSA-N. |
| Q: What is the CAS number of 4-Ethyl-I+/-,2-dihydroxybenzeneacetic acid? |
| A: CAS number of 4-Ethyl-I+/-,2-dihydroxybenzeneacetic acid is 78989-56-7. |
| Q: What is the SMILES notation of 4-Ethyl-I+/-,2-dihydroxybenzeneacetic acid? |
| A: SMILES notation of 4-Ethyl-I+/-,2-dihydroxybenzeneacetic acid is CCc1ccc(C(O)C(=O)O)c(O)c1. |