(2E)-2-[(2,4-dinitrophenyl)hydrazinylidene]propanoic acid structure
|
Common Name | (2E)-2-[(2,4-dinitrophenyl)hydrazinylidene]propanoic acid | ||
|---|---|---|---|---|
| CAS Number | 790-12-5 | Molecular Weight | 268.18300 | |
| Density | 1.64g/cm3 | Boiling Point | 469.9ºC at 760 mmHg | |
| Molecular Formula | C9H8N4O6 | Melting Point | N/A | |
| MSDS | USA | Flash Point | 238ºC | |
| Name | (2Z)-2-[(2,4-dinitrophenyl)hydrazinylidene]propanoic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.64g/cm3 |
|---|---|
| Boiling Point | 469.9ºC at 760 mmHg |
| Molecular Formula | C9H8N4O6 |
| Molecular Weight | 268.18300 |
| Flash Point | 238ºC |
| Exact Mass | 268.04400 |
| PSA | 153.33000 |
| LogP | 2.49480 |
| Index of Refraction | 1.663 |
| InChIKey | CVWXLIFTNILJFS-YHYXMXQVSA-N |
| SMILES | CC(=NNc1ccc([N+](=O)[O-])cc1[N+](=O)[O-])C(=O)O |
|
~%
(2E)-2-[(2,4-di... CAS#:790-12-5 |
| Literature: Fujita, Masaaki; Tamegai, Hideyuki; Eguchi, Tadashi; Kakinuma, Katsumi Bioscience, Biotechnology and Biochemistry, 2001 , vol. 65, # 12 p. 2695 - 2700 |
|
~%
(2E)-2-[(2,4-di... CAS#:790-12-5 |
| Literature: Barman, Pranjit; Bhattacharjee, Saibal Kanti; Bhattacharjee, Tirtha Synthetic Communications, 2011 , vol. 41, # 19 p. 2870 - 2875 |
|
~%
(2E)-2-[(2,4-di... CAS#:790-12-5 |
| Literature: Clift; Cook Biochemical Journal, 1932 , vol. 26, p. 1800,1801 |
| PROPIONALDEHYDE-DNPH |
| 2,4-Dinitrophenylhydrazone of propanal |
| Propanal-DNPH |
| PROPIONALDEHYDE (DNPH DERIVATIVE) |
| 2,4-dinitro-N-(propylideneamino)aniline |
| propionaldehyde-2,4-dnph |
| Propionaldehyde-Dnph,1x1 |
| PROPIONALDEHYDE 2 4-DINITROPHENYLHYDRAZ&2,4-dinitrophenylhydrazone of pyruvic acid |
| 2,4-dinitrophenylhydrazone of propionaldehyde |
| PROPIONALDEHYDE-2,4-DNPH,100MG,NEAT |
| 1-(propylidene)-2-(2,4-dinitrophenyl)hydrazine |
| propanal 2,4-dinitrophenyl hydrazone |
| 2-(2,4-Dinitro-phenylhydrazono)-propionsaeure |
| Brenztraubensaeure-(2.4-dinitro-phenylhydrazon) |
| 2-(2,4-dinitrophenylhydrazono)-propanoic acid |
| propionaldehyde-2,4-dnph solution |
| 2-(2,4-dinitro-phenylhydrazono)-propionic acid |
| pyruvic acid 2,4-dinitrophenyl hydrazone |