N-(phenylsulphonyl)anthranilic acid, compound with 2,2',2''-nitrilotriethanol (1:1) structure
|
Common Name | N-(phenylsulphonyl)anthranilic acid, compound with 2,2',2''-nitrilotriethanol (1:1) | ||
|---|---|---|---|---|
| CAS Number | 79025-97-1 | Molecular Weight | 426.48400 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C19H26N2O7S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 2-(benzenesulfonamido)benzoic acid,2-[bis(2-hydroxyethyl)amino]ethanol |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C19H26N2O7S |
|---|---|
| Molecular Weight | 426.48400 |
| Exact Mass | 426.14600 |
| PSA | 155.78000 |
| LogP | 1.60470 |
| InChIKey | MEHNGRZZBNYXQH-UHFFFAOYSA-N |
| SMILES | O=C(O)c1ccccc1NS(=O)(=O)c1ccccc1.OCCN(CCO)CCO |
| Benzoic acid,2-((phenylsulfonyl)amino)-,compd. with 2,2',2''-nitrilotris(ethanol) (1:1) |
| N-(Phenylsulphonyl)anthranilic acid,compound with 2,2',2''-nitrilotriethanol (1:1) |
| EINECS 279-037-1 |