Fluorescent Brightener ER-III
Modify Date: 2024-02-29 11:14:10
Fluorescent Brightener ER-III structure
|
Common Name | Fluorescent Brightener ER-III | ||
|---|---|---|---|---|
| CAS Number | 79026-03-2 | Molecular Weight | 332.39700 | |
| Density | 1.187 | Boiling Point | 559.4ºC at 760 mmHg | |
| Molecular Formula | C24H16N2 | Melting Point | 214-216ºC | |
| MSDS | N/A | Flash Point | 266ºC | |
Use of Fluorescent Brightener ER-IIIFluorescent Brightener ER-III is a biochemical reagent that can be used as a biological material or organic compound for life science related research. |
| Name | 2-[(E)-2-[4-[(E)-2-(3-cyanophenyl)ethenyl]phenyl]ethenyl]benzonitrile |
|---|---|
| Synonym | More Synonyms |
| Description | Fluorescent Brightener ER-III is a biochemical reagent that can be used as a biological material or organic compound for life science related research. |
|---|---|
| Related Catalog |
| Density | 1.187 |
|---|---|
| Boiling Point | 559.4ºC at 760 mmHg |
| Melting Point | 214-216ºC |
| Molecular Formula | C24H16N2 |
| Molecular Weight | 332.39700 |
| Flash Point | 266ºC |
| Exact Mass | 332.13100 |
| PSA | 47.58000 |
| LogP | 5.77076 |
| Index of Refraction | 1.66 |
| InChIKey | JRVKAPLKKVWGKU-SQIWNDBBSA-N |
| SMILES | N#Cc1cccc(C=Cc2ccc(C=Cc3ccccc3C#N)cc2)c1 |
| Fluorescent Brightener ER-III |
| O250 |
| EINECS 279-038-7 |
| 2-(2-(4-(2-(3-Cyanophenyl)vinyl)phenyl)vinyl)benzonitrile |