ethyl(trioctyl)azanium,methanesulfonate structure
|
Common Name | ethyl(trioctyl)azanium,methanesulfonate | ||
|---|---|---|---|---|
| CAS Number | 79054-30-1 | Molecular Weight | 477.82700 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C27H59NO3S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | ethyl(trioctyl)azanium,methanesulfonate |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C27H59NO3S |
|---|---|
| Molecular Weight | 477.82700 |
| Exact Mass | 477.42200 |
| PSA | 65.58000 |
| LogP | 9.14680 |
| InChIKey | BVNACGCVDUFFQE-UHFFFAOYSA-M |
| SMILES | CCCCCCCC[N+](CC)(CCCCCCCC)CCCCCCCC.CS(=O)(=O)[O-] |
|
~%
ethyl(trioctyl)... CAS#:79054-30-1 |
| Literature: Bunton, Clifford A.; Hong, Young S.; Romsted, Laurence S.; Quan, Clifford Journal of the American Chemical Society, 1981 , vol. 103, # 19 p. 5788 - 5794 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| tri-n-octylethylammonium mesylate |
| 1-Octanaminium,N-ethyl-N,N-dioctyl-,methanesulfonate |