tributyl-(2-nitrophenyl)stannane structure
|
Common Name | tributyl-(2-nitrophenyl)stannane | ||
|---|---|---|---|---|
| CAS Number | 79062-30-9 | Molecular Weight | 412.14500 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C18H31NO2Sn | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | tributyl-(2-nitrophenyl)stannane |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C18H31NO2Sn |
|---|---|
| Molecular Weight | 412.14500 |
| Exact Mass | 413.13800 |
| PSA | 45.82000 |
| LogP | 6.39920 |
| InChIKey | XGQFUVXYDGDHKI-UHFFFAOYSA-N |
| SMILES | CCCC[Sn](CCCC)(CCCC)c1ccccc1[N+](=O)[O-] |
|
~80%
tributyl-(2-nit... CAS#:79062-30-9 |
| Literature: Izgu, Enver Cagri; Hoye, Thomas R. Tetrahedron Letters, 2012 , vol. 53, # 37 p. 4938 - 4941 |
|
~99%
tributyl-(2-nit... CAS#:79062-30-9 |
| Literature: Kosugi, Masanori; Ohya, Takao; Migita, Toshihiko Bulletin of the Chemical Society of Japan, 1983 , vol. 56, # 12 p. 3855 - 3856 |
|
~60%
tributyl-(2-nit... CAS#:79062-30-9 |
| Literature: Kosugi, Masanori; Ohya, Takao; Migita, Toshihiko Bulletin of the Chemical Society of Japan, 1983 , vol. 56, # 12 p. 3855 - 3856 |
| Precursor 4 | |
|---|---|
| DownStream 5 | |
| 2-(tri-n-butylstannyl)-1-nitrobenzene |
| o-(tributylstannyl)nitrobenzene |
| tributylstannyl-2-nitrobenzene |
| tributyl(2-nitrophenyl) stannane |
| 1-tributylstannyl-2-nitrobenzene |
| (2-nitrophenyl)tributylstannane |
| Stannane,tributyl(2-nitrophenyl) |