(6R)-2,3,5,6-Tetrahydro-6-(3-nitrophenyl)imidazo[2,1-b]thiazole
Modify Date: 2025-10-05 11:11:48
![(6R)-2,3,5,6-Tetrahydro-6-(3-nitrophenyl)imidazo[2,1-b]thiazole Structure](https://www.chemsrc.com/extcaspic/006/791007-46-0.png)
(6R)-2,3,5,6-Tetrahydro-6-(3-nitrophenyl)imidazo[2,1-b]thiazole structure
|
Common Name | (6R)-2,3,5,6-Tetrahydro-6-(3-nitrophenyl)imidazo[2,1-b]thiazole | ||
|---|---|---|---|---|
| CAS Number | 791007-46-0 | Molecular Weight | 249.29 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C11H11N3O2S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | (6R)-2,3,5,6-Tetrahydro-6-(3-nitrophenyl)imidazo[2,1-b]thiazole |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C11H11N3O2S |
|---|---|
| Molecular Weight | 249.29 |
| InChIKey | RFAYUIIWPKWNKY-JTQLQIEISA-N |
| SMILES | O=[N+]([O-])c1cccc(C2CN3CCSC3=N2)c1 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the SMILES notation of (6R)-2,3,5,6-Tetrahydro-6-(3-nitrophenyl)imidazo[2,1-b]thiazole? |
| A: SMILES notation of (6R)-2,3,5,6-Tetrahydro-6-(3-nitrophenyl)imidazo[2,1-b]thiazole is O=[N+]([O-])c1cccc(C2CN3CCSC3=N2)c1. |
| Q: What is the molecular formula of (6R)-2,3,5,6-Tetrahydro-6-(3-nitrophenyl)imidazo[2,1-b]thiazole? |
| A: Molecular formula of (6R)-2,3,5,6-Tetrahydro-6-(3-nitrophenyl)imidazo[2,1-b]thiazole is C11H11N3O2S. |
| Q: What is the Chinese name of 791007-46-0? |
| A: Chinese name of 791007-46-0 is 791007-46-0. |
| Q: What is the molecular weight of (6R)-2,3,5,6-Tetrahydro-6-(3-nitrophenyl)imidazo[2,1-b]thiazole? |
| A: Molecular weight of (6R)-2,3,5,6-Tetrahydro-6-(3-nitrophenyl)imidazo[2,1-b]thiazole is 249.29. |
| Q: What is the CAS number of (6R)-2,3,5,6-Tetrahydro-6-(3-nitrophenyl)imidazo[2,1-b]thiazole? |
| A: CAS number of (6R)-2,3,5,6-Tetrahydro-6-(3-nitrophenyl)imidazo[2,1-b]thiazole is 791007-46-0. |
| Q: What is the English name of (6R)-2,3,5,6-Tetrahydro-6-(3-nitrophenyl)imidazo[2,1-b]thiazole? |
| A: The English name of (6R)-2,3,5,6-Tetrahydro-6-(3-nitrophenyl)imidazo[2,1-b]thiazole is (6R)-2,3,5,6-Tetrahydro-6-(3-nitrophenyl)imidazo[2,1-b]thiazole. |
| Q: What is the InChIKey of (6R)-2,3,5,6-Tetrahydro-6-(3-nitrophenyl)imidazo[2,1-b]thiazole? |
| A: InChIKey of (6R)-2,3,5,6-Tetrahydro-6-(3-nitrophenyl)imidazo[2,1-b]thiazole is RFAYUIIWPKWNKY-JTQLQIEISA-N. |