Diospongin A
Modify Date: 2026-07-08 23:36:29
Diospongin A structure
|
Common Name | Diospongin A | ||
|---|---|---|---|---|
| CAS Number | 791104-63-7 | Molecular Weight | 296.4 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C19H20O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | Diospongin A |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C19H20O3 |
|---|---|
| Molecular Weight | 296.4 |
| InChIKey | HQTSVUPKAYCDEB-SCTDSRPQSA-N |
| SMILES | O=C(CC1CC(O)CC(c2ccccc2)O1)c1ccccc1 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the SMILES notation of Diospongin A? |
| A: SMILES notation of Diospongin A is O=C(CC1CC(O)CC(c2ccccc2)O1)c1ccccc1. |
| Q: What is the molecular formula of Diospongin A? |
| A: Molecular formula of Diospongin A is C19H20O3. |
| Q: What is the English name of Diospongin A? |
| A: The English name of Diospongin A is Diospongin A. |
| Q: What is the CAS number of Diospongin A? |
| A: CAS number of Diospongin A is 791104-63-7. |
| Q: What is the InChIKey of Diospongin A? |
| A: InChIKey of Diospongin A is HQTSVUPKAYCDEB-SCTDSRPQSA-N. |
| Q: What is the molecular weight of Diospongin A? |
| A: Molecular weight of Diospongin A is 296.4. |
| Q: What is the Chinese name of 791104-63-7? |
| A: Chinese name of 791104-63-7 is 791104-63-7. |