1-bromo-3-(3-bromo-2-methoxy-5-methylphenyl)-2-methoxy-5-methylbenzene
1-bromo-3-(3-bromo-2-methoxy-5-methylphenyl)-2-methoxy-5-methylbenzene structure
|
Common Name | 1-bromo-3-(3-bromo-2-methoxy-5-methylphenyl)-2-methoxy-5-methylbenzene | ||
|---|---|---|---|---|
| CAS Number | 79115-30-3 | Molecular Weight | 400.10500 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C16H16Br2O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 1-bromo-3-(3-bromo-2-methoxy-5-methylphenyl)-2-methoxy-5-methylbenzene |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C16H16Br2O2 |
|---|---|
| Molecular Weight | 400.10500 |
| Exact Mass | 397.95200 |
| PSA | 18.46000 |
| LogP | 5.51260 |
| InChIKey | SNBCRKMIPXFLRD-UHFFFAOYSA-N |
| SMILES | COc1c(Br)cc(C)cc1-c1cc(C)cc(Br)c1OC |
This table presents publicly reported synthetic routes, reaction conditions, reactants and product information of the compound.
|
~%
1-bromo-3-(3-br... CAS#:79115-30-3 |
| Literature: Bell, Thomas W.; Lein, George M.; Nakamura, Hideo; Cram, Donald J. Journal of Organic Chemistry, 1983 , vol. 48, # 24 p. 4728 - 4734 |
This table lists upstream starting materials and downstream derivative products related to this chemical.
| Precursor 2 | |
|---|---|
| DownStream 0 | |
This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| 1,1'-Biphenyl,3,3'-dibromo-2,2'-dimethoxy-5,5'-dimethyl |
| 3,3'-Dibromo-2,2'-dimethoxy-5,5'-dimethyl(1,1'-biphenyl) |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the SMILES notation of 1-bromo-3-(3-bromo-2-methoxy-5-methylphenyl)-2-methoxy-5-methylbenzene? |
| A: SMILES notation of 1-bromo-3-(3-bromo-2-methoxy-5-methylphenyl)-2-methoxy-5-methylbenzene is COc1c(Br)cc(C)cc1-c1cc(C)cc(Br)c1OC. |
| Q: What are the upstream materials of 1-bromo-3-(3-bromo-2-methoxy-5-methylphenyl)-2-methoxy-5-methylbenzene? |
| A: Related upstream materials(CAS) of 1-bromo-3-(3-bromo-2-methoxy-5-methylphenyl)-2-methoxy-5-methylbenzene: 87682-04-0;74-88-4. |
| Q: What is the English name of 1-bromo-3-(3-bromo-2-methoxy-5-methylphenyl)-2-methoxy-5-methylbenzene? |
| A: The English name of 1-bromo-3-(3-bromo-2-methoxy-5-methylphenyl)-2-methoxy-5-methylbenzene is 1-bromo-3-(3-bromo-2-methoxy-5-methylphenyl)-2-methoxy-5-methylbenzene. |
| Q: What is the LogP of 1-bromo-3-(3-bromo-2-methoxy-5-methylphenyl)-2-methoxy-5-methylbenzene? |
| A: LogP of 1-bromo-3-(3-bromo-2-methoxy-5-methylphenyl)-2-methoxy-5-methylbenzene is 5.51260. |
| Q: What is the molecular weight of 1-bromo-3-(3-bromo-2-methoxy-5-methylphenyl)-2-methoxy-5-methylbenzene? |
| A: Molecular weight of 1-bromo-3-(3-bromo-2-methoxy-5-methylphenyl)-2-methoxy-5-methylbenzene is 400.10500. |
| Q: What is the CAS number of 1-bromo-3-(3-bromo-2-methoxy-5-methylphenyl)-2-methoxy-5-methylbenzene? |
| A: CAS number of 1-bromo-3-(3-bromo-2-methoxy-5-methylphenyl)-2-methoxy-5-methylbenzene is 79115-30-3. |
| Q: What is the polar surface area (PSA) of 1-bromo-3-(3-bromo-2-methoxy-5-methylphenyl)-2-methoxy-5-methylbenzene? |
| A: Polar surface area (PSA) of 1-bromo-3-(3-bromo-2-methoxy-5-methylphenyl)-2-methoxy-5-methylbenzene is 18.46000. |
| Q: What is the molecular formula of 1-bromo-3-(3-bromo-2-methoxy-5-methylphenyl)-2-methoxy-5-methylbenzene? |
| A: Molecular formula of 1-bromo-3-(3-bromo-2-methoxy-5-methylphenyl)-2-methoxy-5-methylbenzene is C16H16Br2O2. |
| Q: What is the InChIKey of 1-bromo-3-(3-bromo-2-methoxy-5-methylphenyl)-2-methoxy-5-methylbenzene? |
| A: InChIKey of 1-bromo-3-(3-bromo-2-methoxy-5-methylphenyl)-2-methoxy-5-methylbenzene is SNBCRKMIPXFLRD-UHFFFAOYSA-N. |
| Q: What English synonyms does 1-bromo-3-(3-bromo-2-methoxy-5-methylphenyl)-2-methoxy-5-methylbenzene have? |
| A: English synonyms of 1-bromo-3-(3-bromo-2-methoxy-5-methylphenyl)-2-methoxy-5-methylbenzene: 1,1'-Biphenyl,3,3'-dibromo-2,2'-dimethoxy-5,5'-dimethyl, 3,3'-Dibromo-2,2'-dimethoxy-5,5'-dimethyl(1,1'-biphenyl). |