methyl 2,6-dimethoxy-5-[3-(oxan-2-yloxy)prop-1-ynyl]pyrimidine-4-carboxylate structure
|
Common Name | methyl 2,6-dimethoxy-5-[3-(oxan-2-yloxy)prop-1-ynyl]pyrimidine-4-carboxylate | ||
|---|---|---|---|---|
| CAS Number | 79115-67-6 | Molecular Weight | 336.34000 | |
| Density | 1.27g/cm3 | Boiling Point | 526.9ºC at 760 mmHg | |
| Molecular Formula | C16H20N2O6 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 272.5ºC | |
| Name | methyl 2,6-dimethoxy-5-[3-(oxan-2-yloxy)prop-1-ynyl]pyrimidine-4-carboxylate |
|---|
| Density | 1.27g/cm3 |
|---|---|
| Boiling Point | 526.9ºC at 760 mmHg |
| Molecular Formula | C16H20N2O6 |
| Molecular Weight | 336.34000 |
| Flash Point | 272.5ºC |
| Exact Mass | 336.13200 |
| PSA | 89.00000 |
| LogP | 1.17510 |
| Index of Refraction | 1.538 |
| InChIKey | YYWRCZOCLZRFCU-UHFFFAOYSA-N |
| SMILES | COC(=O)c1nc(OC)nc(OC)c1C#CCOC1CCCCO1 |
|
~87%
methyl 2,6-dime... CAS#:79115-67-6 |
| Literature: Bhatt; Kundu; Chwang; Heidelberger Journal of Heterocyclic Chemistry, 1981 , vol. 18, # 4 p. 771 - 774 |
|
~%
methyl 2,6-dime... CAS#:79115-67-6 |
| Literature: Bhatt; Kundu; Chwang; Heidelberger Journal of Heterocyclic Chemistry, 1981 , vol. 18, # 4 p. 771 - 774 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |