A-7 hydrochloride structure
|
Common Name | A-7 hydrochloride | ||
|---|---|---|---|---|
| CAS Number | 79127-24-5 | Molecular Weight | 433.44 | |
| Density | N/A | Boiling Point | 551ºC at 760 mmHg | |
| Molecular Formula | C20H30Cl2N2O2S | Melting Point | 186-188ºC | |
| MSDS | N/A | Flash Point | 287ºC | |
Use of A-7 hydrochlorideA-7 hydrochloride (Ophobolin A) is a calmodulin antagonist and can be used for the research of cancer[1]. |
| Name | N-(10-aminodecyl)-5-chloronaphthalene-1-sulfonamide,hydrochloride |
|---|---|
| Synonym | More Synonyms |
| Description | A-7 hydrochloride (Ophobolin A) is a calmodulin antagonist and can be used for the research of cancer[1]. |
|---|---|
| Related Catalog | |
| References |
| Boiling Point | 551ºC at 760 mmHg |
|---|---|
| Melting Point | 186-188ºC |
| Molecular Formula | C20H30Cl2N2O2S |
| Molecular Weight | 433.44 |
| Flash Point | 287ºC |
| Exact Mass | 432.140503 |
| PSA | 80.57000 |
| LogP | 7.82500 |
| InChIKey | XDJCAQBTSCRBHS-UHFFFAOYSA-N |
| SMILES | Cl.NCCCCCCCCCCNS(=O)(=O)c1cccc2c(Cl)cccc12 |
| HS Code | 2935009090 |
|---|
| HS Code | 2935009090 |
|---|---|
| Summary | 2935009090 other sulphonamides VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:35.0% |
| N-(10-aminodecyl)-5-chloronaphthalene-1-sulfonamide hydrochloride |
| 1-Decanaminium, 10-[[(5-chloro-1-naphthalenyl)sulfonyl]amino]-, chloride (1:1) |
| N-(10-Aminodecyl)-5-chloronaphthalene-1-sulfonamide hydrochloride (1:1) |
| OR0375T |
| 10-{[(5-Chloro-1-naphthyl)sulfonyl]amino}-1-decanaminium chloride |
| A-7 HYDROCHLORIDE |
| 1-[(10-Aminodec-1-yl)sulphamoyl]-5-chloronaphthalene |