4-methyl-N-[10-[(4-methylphenyl)sulfonylamino]decyl]benzenesulfonamide
Modify Date: 2025-09-25 11:06:14
![4-methyl-N-[10-[(4-methylphenyl)sulfonylamino]decyl]benzenesulfonamide Structure](https://image.chemsrc.com/caspic/131/79130-37-3.png)
4-methyl-N-[10-[(4-methylphenyl)sulfonylamino]decyl]benzenesulfonamide structure
|
Common Name | 4-methyl-N-[10-[(4-methylphenyl)sulfonylamino]decyl]benzenesulfonamide | ||
|---|---|---|---|---|
| CAS Number | 79130-37-3 | Molecular Weight | 480.68400 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C24H36N2O4S2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 4-methyl-N-[10-[(4-methylphenyl)sulfonylamino]decyl]benzenesulfonamide |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C24H36N2O4S2 |
|---|---|
| Molecular Weight | 480.68400 |
| Exact Mass | 480.21200 |
| PSA | 109.10000 |
| LogP | 7.62440 |
| InChIKey | OTOUFLXSMOCJOU-UHFFFAOYSA-N |
| SMILES | Cc1ccc(S(=O)(=O)NCCCCCCCCCCNS(=O)(=O)c2ccc(C)cc2)cc1 |
|
~94%
4-methyl-N-[10-... CAS#:79130-37-3 |
| Literature: Hosseini, Mir Wais; Lehn, Jean-Marie Helvetica Chimica Acta, 1986 , vol. 69, p. 587 - 603 |
|
~97%
4-methyl-N-[10-... CAS#:79130-37-3 |
| Literature: Hosseini, M. W.; Lehn, J. M. Journal of the American Chemical Society, 1982 , vol. 104, # 12 p. 3525 - 3527 |
|
~75%
4-methyl-N-[10-... CAS#:79130-37-3 |
| Literature: Isele, Gerand; Martinez, Julian Aranda; Schill, Gottfried Synthesis, 1981 , # 6 p. 455 - 457 |
CAS#:87338-09-8
CAS#:87338-10-1
CAS#:87338-11-2
CAS#:87338-12-3| 1,10-bis<(p-tolylsulfonyl)amino>decane |
| N,N'-decanediyl-bis-toluene-4-sulfonamide |
| N,N'-Decandiyl-bis-toluol-4-sulfonamid |
| N1,N10-di(p-toluenesulfonyl)-1,10-diamidecane |
| N,N'-bis-p-toluenesulfonyl-1,10-decanediamine |
| Benzenesulfonamide,N,N'-1,10-decanediylbis[4-methyl |
| 1,10-bis(p-tolylsulfonyl)-1,10-decanediamine |
| 1,10-Bis<tosylamino>-decan |