[4,4-bis(ethylsulfanyl)-1-phenylbuta-1,2,3-trienyl]benzene
![[4,4-bis(ethylsulfanyl)-1-phenylbuta-1,2,3-trienyl]benzene Structure](https://image.chemsrc.com/caspic/437/79159-18-5.png)
[4,4-bis(ethylsulfanyl)-1-phenylbuta-1,2,3-trienyl]benzene structure
|
Common Name | [4,4-bis(ethylsulfanyl)-1-phenylbuta-1,2,3-trienyl]benzene | ||
|---|---|---|---|---|
| CAS Number | 79159-18-5 | Molecular Weight | 324.50300 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C20H20S2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | [4,4-bis(ethylsulfanyl)-1-phenylbuta-1,2,3-trienyl]benzene |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C20H20S2 |
|---|---|
| Molecular Weight | 324.50300 |
| Exact Mass | 324.10100 |
| PSA | 50.60000 |
| LogP | 6.21990 |
| InChIKey | PIAYKADWBPTJRX-UHFFFAOYSA-N |
| SMILES | CCSC(=C=C=C(c1ccccc1)c1ccccc1)SCC |
This table presents publicly reported synthetic routes, reaction conditions, reactants and product information of the compound.
|
~%
[4,4-bis(ethyls... CAS#:79159-18-5 |
| Literature: Bestmann, Hans Juergen; Roth, Kurt Tetrahedron Letters, 1981 , vol. 22, # 18 p. 1681 - 1684 |
|
~%
[4,4-bis(ethyls... CAS#:79159-18-5 |
| Literature: Bestmann, Hans Juergen; Roth, Kurt Tetrahedron Letters, 1981 , vol. 22, # 18 p. 1681 - 1684 |
![[Bis(ethylthio)vinyliden]triphenylphosphoran structure](https://image.chemsrc.com/caspic/344/79159-25-4.png)
This table lists upstream starting materials and downstream derivative products related to this chemical.
| Precursor 2 | |
|---|---|
| DownStream 0 | |
This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| Benzene,1,1'-[4,4-bis(ethylthio)-1,2,3-butatrienylidene]bis |
| 1.1-Bis(ethylthio)-3.3-diphenyl-butatrien |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the SMILES notation of [4,4-bis(ethylsulfanyl)-1-phenylbuta-1,2,3-trienyl]benzene? |
| A: SMILES notation of [4,4-bis(ethylsulfanyl)-1-phenylbuta-1,2,3-trienyl]benzene is CCSC(=C=C=C(c1ccccc1)c1ccccc1)SCC. |
| Q: What is the InChIKey of [4,4-bis(ethylsulfanyl)-1-phenylbuta-1,2,3-trienyl]benzene? |
| A: InChIKey of [4,4-bis(ethylsulfanyl)-1-phenylbuta-1,2,3-trienyl]benzene is PIAYKADWBPTJRX-UHFFFAOYSA-N. |
| Q: What is the CAS number of [4,4-bis(ethylsulfanyl)-1-phenylbuta-1,2,3-trienyl]benzene? |
| A: CAS number of [4,4-bis(ethylsulfanyl)-1-phenylbuta-1,2,3-trienyl]benzene is 79159-18-5. |
| Q: What is the LogP of [4,4-bis(ethylsulfanyl)-1-phenylbuta-1,2,3-trienyl]benzene? |
| A: LogP of [4,4-bis(ethylsulfanyl)-1-phenylbuta-1,2,3-trienyl]benzene is 6.21990. |
| Q: What are the upstream materials of [4,4-bis(ethylsulfanyl)-1-phenylbuta-1,2,3-trienyl]benzene? |
| A: Related upstream materials(CAS) of [4,4-bis(ethylsulfanyl)-1-phenylbuta-1,2,3-trienyl]benzene: 79159-30-1;79159-25-4. |
| Q: What is the molecular weight of [4,4-bis(ethylsulfanyl)-1-phenylbuta-1,2,3-trienyl]benzene? |
| A: Molecular weight of [4,4-bis(ethylsulfanyl)-1-phenylbuta-1,2,3-trienyl]benzene is 324.50300. |
| Q: What is the Chinese name of 79159-18-5? |
| A: Chinese name of 79159-18-5 is 79159-18-5. |
| Q: What is the molecular formula of [4,4-bis(ethylsulfanyl)-1-phenylbuta-1,2,3-trienyl]benzene? |
| A: Molecular formula of [4,4-bis(ethylsulfanyl)-1-phenylbuta-1,2,3-trienyl]benzene is C20H20S2. |
| Q: What is the polar surface area (PSA) of [4,4-bis(ethylsulfanyl)-1-phenylbuta-1,2,3-trienyl]benzene? |
| A: Polar surface area (PSA) of [4,4-bis(ethylsulfanyl)-1-phenylbuta-1,2,3-trienyl]benzene is 50.60000. |
| Q: What is the English name of [4,4-bis(ethylsulfanyl)-1-phenylbuta-1,2,3-trienyl]benzene? |
| A: The English name of [4,4-bis(ethylsulfanyl)-1-phenylbuta-1,2,3-trienyl]benzene is [4,4-bis(ethylsulfanyl)-1-phenylbuta-1,2,3-trienyl]benzene. |