Methanone,(4-methoxyphenyl)[4-(phenylamino)-1H-pyrazol-3-yl]
![Methanone,(4-methoxyphenyl)[4-(phenylamino)-1H-pyrazol-3-yl] Structure](https://image.chemsrc.com/caspic/430/79159-45-8.png)
Methanone,(4-methoxyphenyl)[4-(phenylamino)-1H-pyrazol-3-yl] structure
|
Common Name | Methanone,(4-methoxyphenyl)[4-(phenylamino)-1H-pyrazol-3-yl] | ||
|---|---|---|---|---|
| CAS Number | 79159-45-8 | Molecular Weight | 293.32000 | |
| Density | 1.28g/cm3 | Boiling Point | 556.4ºC at 760mmHg | |
| Molecular Formula | C17H15N3O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 290.3ºC | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | (4-anilino-1H-pyrazol-5-yl)-(4-methoxyphenyl)methanone |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Density | 1.28g/cm3 |
|---|---|
| Boiling Point | 556.4ºC at 760mmHg |
| Molecular Formula | C17H15N3O2 |
| Molecular Weight | 293.32000 |
| Flash Point | 290.3ºC |
| Exact Mass | 293.11600 |
| PSA | 67.01000 |
| LogP | 3.46590 |
| Index of Refraction | 1.66 |
| InChIKey | WTINMPDZNRRMGE-UHFFFAOYSA-N |
| SMILES | COc1ccc(C(=O)c2[nH]ncc2Nc2ccccc2)cc1 |
This table presents publicly reported synthetic routes, reaction conditions, reactants and product information of the compound.
|
~%
Methanone,(4-me... CAS#:79159-45-8 |
| Literature: Bestmann, Hans Juergen; Schmid, Guenter Tetrahedron Letters, 1981 , vol. 22, # 18 p. 1679 - 1680 |
|
~%
Methanone,(4-me... CAS#:79159-45-8 |
| Literature: Bestmann, Hans Juergen; Schmid, Guenter Tetrahedron Letters, 1981 , vol. 22, # 18 p. 1679 - 1680 |
![triphenyl[(phenylimino)ethenylidene]phosphorane structure](https://image.chemsrc.com/caspic/326/64448-06-2.png)
This table lists upstream starting materials and downstream derivative products related to this chemical.
| Precursor 2 | |
|---|---|
| DownStream 0 | |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the InChIKey of (4-anilino-1H-pyrazol-5-yl)-(4-methoxyphenyl)methanone? |
| A: InChIKey of (4-anilino-1H-pyrazol-5-yl)-(4-methoxyphenyl)methanone is WTINMPDZNRRMGE-UHFFFAOYSA-N. |
| Q: What is the LogP of (4-anilino-1H-pyrazol-5-yl)-(4-methoxyphenyl)methanone? |
| A: LogP of (4-anilino-1H-pyrazol-5-yl)-(4-methoxyphenyl)methanone is 3.46590. |
| Q: What is the molecular weight of (4-anilino-1H-pyrazol-5-yl)-(4-methoxyphenyl)methanone? |
| A: Molecular weight of (4-anilino-1H-pyrazol-5-yl)-(4-methoxyphenyl)methanone is 293.32000. |
| Q: What is the CAS number of (4-anilino-1H-pyrazol-5-yl)-(4-methoxyphenyl)methanone? |
| A: CAS number of (4-anilino-1H-pyrazol-5-yl)-(4-methoxyphenyl)methanone is 79159-45-8. |
| Q: What is the SMILES notation of (4-anilino-1H-pyrazol-5-yl)-(4-methoxyphenyl)methanone? |
| A: SMILES notation of (4-anilino-1H-pyrazol-5-yl)-(4-methoxyphenyl)methanone is COc1ccc(C(=O)c2[nH]ncc2Nc2ccccc2)cc1. |
| Q: What is the polar surface area (PSA) of (4-anilino-1H-pyrazol-5-yl)-(4-methoxyphenyl)methanone? |
| A: Polar surface area (PSA) of (4-anilino-1H-pyrazol-5-yl)-(4-methoxyphenyl)methanone is 67.01000. |
| Q: What is the English name of (4-anilino-1H-pyrazol-5-yl)-(4-methoxyphenyl)methanone? |
| A: The English name of (4-anilino-1H-pyrazol-5-yl)-(4-methoxyphenyl)methanone is (4-anilino-1H-pyrazol-5-yl)-(4-methoxyphenyl)methanone. |
| Q: What is the molecular formula of (4-anilino-1H-pyrazol-5-yl)-(4-methoxyphenyl)methanone? |
| A: Molecular formula of (4-anilino-1H-pyrazol-5-yl)-(4-methoxyphenyl)methanone is C17H15N3O2. |
| Q: What is the Chinese name of 79159-45-8? |
| A: Chinese name of 79159-45-8 is 79159-45-8. |
| Q: What is the boiling point of (4-anilino-1H-pyrazol-5-yl)-(4-methoxyphenyl)methanone? |
| A: Boiling point of (4-anilino-1H-pyrazol-5-yl)-(4-methoxyphenyl)methanone is 556.4ºC at 760mmHg. |
This table lists manufacturers and suppliers of this compound, including vendor names and product supply reference information.
| Dayang Chem (Hangzhou) Co., Ltd. |