3-Chloro-4,5-dihydroxybenzoic acid structure
|
Common Name | 3-Chloro-4,5-dihydroxybenzoic acid | ||
|---|---|---|---|---|
| CAS Number | 79188-95-7 | Molecular Weight | 188.56 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C7H5ClO4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 3-Chloro-4,5-dihydroxybenzoic acid |
|---|
| Molecular Formula | C7H5ClO4 |
|---|---|
| Molecular Weight | 188.56 |
| InChIKey | GGUNECQLDCNDDY-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(C(=C1O)O)Cl)C(=O)O |
|
Name: NCI human tumor cell line growth inhibition assay. Data for the MCF7 Non-Small Cell L...
Source: DTP/NCI
Target: N/A
External Id: MCF7_OneDose
|
|
Name: NCI human tumor cell line growth inhibition assay. Data for the IGROV1 Non-Small Cell...
Source: DTP/NCI
Target: N/A
External Id: IGROV1_OneDose
|