(3,4-dimethoxyphenyl)-(3-methoxyphenyl)methanone
(3,4-dimethoxyphenyl)-(3-methoxyphenyl)methanone structure
|
Common Name | (3,4-dimethoxyphenyl)-(3-methoxyphenyl)methanone | ||
|---|---|---|---|---|
| CAS Number | 792-57-4 | Molecular Weight | 272.29600 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C16H16O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | (3,4-dimethoxyphenyl)-(3-methoxyphenyl)methanone |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C16H16O4 |
|---|---|
| Molecular Weight | 272.29600 |
| Exact Mass | 272.10500 |
| PSA | 44.76000 |
| LogP | 2.94340 |
| InChIKey | KMGZOIGHMXBEDL-UHFFFAOYSA-N |
| SMILES | COc1cccc(C(=O)c2ccc(OC)c(OC)c2)c1 |
This table presents publicly reported synthetic routes, reaction conditions, reactants and product information of the compound.
|
~99%
(3,4-dimethoxyp... CAS#:792-57-4 |
| Literature: Celgene Corporation Patent: US2005/107339 A1, 2005 ; |
|
~83%
(3,4-dimethoxyp... CAS#:792-57-4 |
| Literature: Sharghi, Hashem; Tamaddon, Fatemeh Tetrahedron, 1996 , vol. 52, # 43 p. 13623 - 13640 |
This table lists upstream starting materials and downstream derivative products related to this chemical.
| Precursor 3 | |
|---|---|
| DownStream 0 | |
This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| 3,4-dimethoxy-3'-methoxybenzophenone |
| 3,4,3'-Trimethoxy-benzophenon |
| 3',3,4-trimethoxybenzophenone |
| 3,3',4-Trimethoxybenzophenon |
| 3,4,3'-trimethoxy-benzophenone |
| (3,4-dimethoxyphenyl)(3-methoxyphenyl)-methanone |
| Methanone,(3,4-dimethoxyphenyl)(3-methoxyphenyl) |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the polar surface area (PSA) of (3,4-dimethoxyphenyl)-(3-methoxyphenyl)methanone? |
| A: Polar surface area (PSA) of (3,4-dimethoxyphenyl)-(3-methoxyphenyl)methanone is 44.76000. |
| Q: What is the Chinese name of 792-57-4? |
| A: Chinese name of 792-57-4 is 792-57-4. |
| Q: What is the CAS number of (3,4-dimethoxyphenyl)-(3-methoxyphenyl)methanone? |
| A: CAS number of (3,4-dimethoxyphenyl)-(3-methoxyphenyl)methanone is 792-57-4. |
| Q: What English synonyms does (3,4-dimethoxyphenyl)-(3-methoxyphenyl)methanone have? |
| A: English synonyms of (3,4-dimethoxyphenyl)-(3-methoxyphenyl)methanone: 3,4-dimethoxy-3'-methoxybenzophenone, 3,4,3'-Trimethoxy-benzophenon, 3',3,4-trimethoxybenzophenone, 3,3',4-Trimethoxybenzophenon, 3,4,3'-trimethoxy-benzophenone, (3,4-dimethoxyphenyl)(3-methoxyphenyl)-methanone, Methanone,(3,4-dimethoxyphenyl)(3-methoxyphenyl). |
| Q: What is the SMILES notation of (3,4-dimethoxyphenyl)-(3-methoxyphenyl)methanone? |
| A: SMILES notation of (3,4-dimethoxyphenyl)-(3-methoxyphenyl)methanone is COc1cccc(C(=O)c2ccc(OC)c(OC)c2)c1. |
| Q: What is the molecular formula of (3,4-dimethoxyphenyl)-(3-methoxyphenyl)methanone? |
| A: Molecular formula of (3,4-dimethoxyphenyl)-(3-methoxyphenyl)methanone is C16H16O4. |
| Q: What are the upstream materials of (3,4-dimethoxyphenyl)-(3-methoxyphenyl)methanone? |
| A: Related upstream materials(CAS) of (3,4-dimethoxyphenyl)-(3-methoxyphenyl)methanone: 91-16-7;1711-05-3;586-38-9. |
| Q: What is the LogP of (3,4-dimethoxyphenyl)-(3-methoxyphenyl)methanone? |
| A: LogP of (3,4-dimethoxyphenyl)-(3-methoxyphenyl)methanone is 2.94340. |
| Q: What is the molecular weight of (3,4-dimethoxyphenyl)-(3-methoxyphenyl)methanone? |
| A: Molecular weight of (3,4-dimethoxyphenyl)-(3-methoxyphenyl)methanone is 272.29600. |
| Q: What is the English name of (3,4-dimethoxyphenyl)-(3-methoxyphenyl)methanone? |
| A: The English name of (3,4-dimethoxyphenyl)-(3-methoxyphenyl)methanone is (3,4-dimethoxyphenyl)-(3-methoxyphenyl)methanone. |