trimethyl-((e)-3-phenyl-but-2-enyl)-silane structure
|
Common Name | trimethyl-((e)-3-phenyl-but-2-enyl)-silane | ||
|---|---|---|---|---|
| CAS Number | 79239-05-7 | Molecular Weight | 204.38300 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C13H20Si | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | trimethyl-((e)-3-phenyl-but-2-enyl)-silane |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C13H20Si |
|---|---|
| Molecular Weight | 204.38300 |
| Exact Mass | 204.13300 |
| LogP | 4.42810 |
| InChIKey | JYAACCIGESKZNR-ZRDIBKRKSA-N |
| SMILES | CC(=CC[Si](C)(C)C)c1ccccc1 |
|
~%
trimethyl-((e)-... CAS#:79239-05-7 |
| Literature: Fleming, Ian; Patel, Shailesh K.; Urch, Christopher J. Journal of the Chemical Society, Perkin Transactions 1: Organic and Bio-Organic Chemistry (1972-1999), 1989 , p. 115 - 124 |
|
~%
trimethyl-((e)-... CAS#:79239-05-7 |
| Literature: Fleming, Ian; Patel, Shailesh K.; Urch, Christopher J. Journal of the Chemical Society, Perkin Transactions 1: Organic and Bio-Organic Chemistry (1972-1999), 1989 , p. 115 - 124 |
|
~%
trimethyl-((e)-... CAS#:79239-05-7 |
| Literature: Fleming, Ian; Patel, Shailesh K.; Urch, Christopher J. Journal of the Chemical Society, Perkin Transactions 1: Organic and Bio-Organic Chemistry (1972-1999), 1989 , p. 115 - 124 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |
| cis/trans-3,7-dimethyl-2-octeal |
| (E/Z)-3-phenyl-1-(trimethylsilyl)-2-butene |
| 3,7-dimethyl-2-octenal |
| (E/Z)-3-heptene |
| (E/Z)-1-(Trimethylsilyl)-3-phenylbut-2-ene |
| (E)-Trimethyl(3-phenylbut-2-en-1-yl)silane |
| 3,7-dimethyl-oct-2-enal |
| 2-phenyl-4-trimethylsilylbut-2-ene |
| (Z)-3,7-dimethyloct-2-enal |
| (E/Z)-3,7-dimethyl-2-octenal |
| (Z,E)-hept-3-ene |
| n-3-heptene |