Z-Tic-OtBu
Modify Date: 2026-08-09 21:30:20
Z-Tic-OtBu structure
|
Common Name | Z-Tic-OtBu | ||
|---|---|---|---|---|
| CAS Number | 79276-05-4 | Molecular Weight | 367.43800 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C22H25NO4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | Z-Tic-OtBu |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C22H25NO4 |
|---|---|
| Molecular Weight | 367.43800 |
| Exact Mass | 367.17800 |
| PSA | 55.84000 |
| LogP | 4.02970 |
| InChIKey | ZVAGKGPAVFTCFY-IBGZPJMESA-N |
| SMILES | CC(C)(C)OC(=O)C1Cc2ccccc2CN1C(=O)OCc1ccccc1 |
This table lists upstream starting materials and downstream derivative products related to this chemical.
| Precursor 0 | |
|---|---|
| DownStream 1 | |
CAS#:77497-74-6This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the English name of Z-Tic-OtBu? |
| A: The English name of Z-Tic-OtBu is Z-Tic-OtBu. |
| Q: What is the InChIKey of Z-Tic-OtBu? |
| A: InChIKey of Z-Tic-OtBu is ZVAGKGPAVFTCFY-IBGZPJMESA-N. |
| Q: What is the CAS number of Z-Tic-OtBu? |
| A: CAS number of Z-Tic-OtBu is 79276-05-4. |
| Q: What is the molecular formula of Z-Tic-OtBu? |
| A: Molecular formula of Z-Tic-OtBu is C22H25NO4. |
| Q: What is the Chinese name of 79276-05-4? |
| A: Chinese name of 79276-05-4 is 79276-05-4. |
| Q: What is the polar surface area (PSA) of Z-Tic-OtBu? |
| A: Polar surface area (PSA) of Z-Tic-OtBu is 55.84000. |
| Q: What are the downstream products of Z-Tic-OtBu? |
| A: Related downstream products(CAS) of Z-Tic-OtBu: 77497-74-6. |
| Q: What is the molecular weight of Z-Tic-OtBu? |
| A: Molecular weight of Z-Tic-OtBu is 367.43800. |
| Q: What is the SMILES notation of Z-Tic-OtBu? |
| A: SMILES notation of Z-Tic-OtBu is CC(C)(C)OC(=O)C1Cc2ccccc2CN1C(=O)OCc1ccccc1. |
| Q: What is the LogP of Z-Tic-OtBu? |
| A: LogP of Z-Tic-OtBu is 4.02970. |