1,3-Benzenediol, 5-(7-((2E)-3,7-dimethyl-2,6-octadienyl)-6-methoxy-2-b enzofuranyl)- structure
|
Common Name | 1,3-Benzenediol, 5-(7-((2E)-3,7-dimethyl-2,6-octadienyl)-6-methoxy-2-b enzofuranyl)- | ||
|---|---|---|---|---|
| CAS Number | 79295-49-1 | Molecular Weight | 392.48700 | |
| Density | 1.14g/cm3 | Boiling Point | 579.2ºC at 760 mmHg | |
| Molecular Formula | C25H28O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 304.1ºC | |
Use of 1,3-Benzenediol, 5-(7-((2E)-3,7-dimethyl-2,6-octadienyl)-6-methoxy-2-b enzofuranyl)-Mulberrofuran B can be isolated from the Ethanol extract of Morus alba. Mulberrofuran B has antioxidant activity[1]. |
| Name | 5-[7-[(2E)-3,7-dimethylocta-2,6-dienyl]-6-methoxy-1-benzofuran-2-yl]benzene-1,3-diol |
|---|---|
| Synonym | More Synonyms |
| Description | Mulberrofuran B can be isolated from the Ethanol extract of Morus alba. Mulberrofuran B has antioxidant activity[1]. |
|---|---|
| Related Catalog | |
| References |
| Density | 1.14g/cm3 |
|---|---|
| Boiling Point | 579.2ºC at 760 mmHg |
| Molecular Formula | C25H28O4 |
| Molecular Weight | 392.48700 |
| Flash Point | 304.1ºC |
| Exact Mass | 392.19900 |
| PSA | 62.83000 |
| LogP | 6.75480 |
| Index of Refraction | 1.6 |
| InChIKey | OZLRLDMVAJOIKX-CAOOACKPSA-N |
| SMILES | COc1ccc2cc(-c3cc(O)cc(O)c3)oc2c1CC=C(C)CCC=C(C)C |
|
~%
1,3-Benzenediol... CAS#:79295-49-1 |
| Literature: Mann; Widdowson; Clough Tetrahedron, 1991 , vol. 47, # 37 p. 7991 - 8000 |
|
~%
1,3-Benzenediol... CAS#:79295-49-1 |
| Literature: Mann; Widdowson; Clough Tetrahedron, 1991 , vol. 47, # 37 p. 7991 - 8000 |
|
~%
1,3-Benzenediol... CAS#:79295-49-1 |
| Literature: Mann; Widdowson; Clough Tetrahedron, 1991 , vol. 47, # 37 p. 7991 - 8000 |
|
~%
1,3-Benzenediol... CAS#:79295-49-1 |
| Literature: Mann; Widdowson; Clough Tetrahedron, 1991 , vol. 47, # 37 p. 7991 - 8000 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |
| 5-(7-((2E)-3,7-DIMETHYL-2,6-OCTADIENYL)-6-METHOXY-2-BENZOFURANYL)RESORCINOL |
| 1,3-Benzenediol,5-(7-((2E)-3,7-dimethyl-2,6-octadienyl)-6-methoxy-2-benzofuranyl) |
| mulberrofuran B |