1,4-Piperazinediethanol,2,2,5,5-tetramethyl- structure
|
Common Name | 1,4-Piperazinediethanol,2,2,5,5-tetramethyl- | ||
|---|---|---|---|---|
| CAS Number | 79305-90-1 | Molecular Weight | 230.34700 | |
| Density | 0.977g/cm3 | Boiling Point | 334.6ºC at 760mmHg | |
| Molecular Formula | C12H26N2O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 143.9ºC | |
| Name | 2-[4-(2-hydroxyethyl)-2,2,5,5-tetramethylpiperazin-1-yl]ethanol |
|---|---|
| Synonym | More Synonyms |
| Density | 0.977g/cm3 |
|---|---|
| Boiling Point | 334.6ºC at 760mmHg |
| Molecular Formula | C12H26N2O2 |
| Molecular Weight | 230.34700 |
| Flash Point | 143.9ºC |
| Exact Mass | 230.19900 |
| PSA | 46.94000 |
| LogP | 0.02160 |
| Index of Refraction | 1.471 |
| InChIKey | POAIVAPYMDRWLF-UHFFFAOYSA-N |
| SMILES | CC1(C)CN(CCO)C(C)(C)CN1CCO |
|
~%
1,4-Piperazined... CAS#:79305-90-1 |
| Literature: McElvain; Pryde Journal of the American Chemical Society, 1949 , vol. 71, p. 326,329 |
|
~%
1,4-Piperazined... CAS#:79305-90-1 |
| Literature: McElvain; Pryde Journal of the American Chemical Society, 1949 , vol. 71, p. 326,329 |
|
~%
1,4-Piperazined... CAS#:79305-90-1 |
| Literature: McElvain; Pryde Journal of the American Chemical Society, 1949 , vol. 71, p. 326,329 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |
| 1,4-Piperazinediethanol,2,2,5,5-tetramethyl |
| 1,4-Bis-(2-hydroxy-aethyl)-2,2,5,5-tetramethyl-piperazin |
| 2,2'-(2,2,5,5-tetramethylpiperazine-1,4-diyl)diethanol |
| 1,4-bis-(2-hydroxy-ethyl)-2,2,5,5-tetramethyl-piperazine |