ethyl 3-oxo-2-acetyl-4-Methylpentanoate
ethyl 3-oxo-2-acetyl-4-Methylpentanoate structure
|
Common Name | ethyl 3-oxo-2-acetyl-4-Methylpentanoate | ||
|---|---|---|---|---|
| CAS Number | 79322-87-5 | Molecular Weight | 200.23200 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C10H16O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Summary: ethyl 2-acetyl-4-methyl-3-oxopentanoate (CAS: 79322-87-5, molecular formula: C10H16O4, molecular weight: 200.23200) is a chemical compound. For research-use only, not for medical or clinical usage.
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | ethyl 2-acetyl-4-methyl-3-oxopentanoate |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C10H16O4 |
|---|---|
| Molecular Weight | 200.23200 |
| Exact Mass | 200.10500 |
| PSA | 60.44000 |
| LogP | 0.97980 |
| InChIKey | JTJFOCUKLZZANK-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C(C(C)=O)C(=O)C(C)C |
This table lists upstream starting materials and downstream derivative products related to this chemical.
| Precursor 0 | |
|---|---|
| DownStream 6 | |
CAS#:42558-54-3
CAS#:563-80-4
CAS#:64-17-5
CAS#:64-19-7
CAS#:7307-03-1
CAS#:90087-36-8This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| 2-Isobutyryl-acetessigsaeure-ethylester |
| ethyl 3-oxo-2-acetyl-4-methylpentanoate |
| 2-acetyl-4-methyl-3-oxo-pentanoic acid ethyl ester |
| 2-Acetyl-4-methyl-3-oxo-valeriansaeure-aethylester |
| 2-acetyl-4-methyl-3-oxo-valeric acid ethyl ester |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the molecular weight of ethyl 2-acetyl-4-methyl-3-oxopentanoate? |
| A: Molecular weight of ethyl 2-acetyl-4-methyl-3-oxopentanoate is 200.23200. |
| Q: What is the SMILES notation of ethyl 2-acetyl-4-methyl-3-oxopentanoate? |
| A: SMILES notation of ethyl 2-acetyl-4-methyl-3-oxopentanoate is CCOC(=O)C(C(C)=O)C(=O)C(C)C. |
| Q: What is the InChIKey of ethyl 2-acetyl-4-methyl-3-oxopentanoate? |
| A: InChIKey of ethyl 2-acetyl-4-methyl-3-oxopentanoate is JTJFOCUKLZZANK-UHFFFAOYSA-N. |
| Q: What is the polar surface area (PSA) of ethyl 2-acetyl-4-methyl-3-oxopentanoate? |
| A: Polar surface area (PSA) of ethyl 2-acetyl-4-methyl-3-oxopentanoate is 60.44000. |
| Q: What is the CAS number of ethyl 2-acetyl-4-methyl-3-oxopentanoate? |
| A: CAS number of ethyl 2-acetyl-4-methyl-3-oxopentanoate is 79322-87-5. |
| Q: What is the Chinese name of 79322-87-5? |
| A: Chinese name of 79322-87-5 is 79322-87-5. |
| Q: What is the English name of ethyl 2-acetyl-4-methyl-3-oxopentanoate? |
| A: The English name of ethyl 2-acetyl-4-methyl-3-oxopentanoate is ethyl 2-acetyl-4-methyl-3-oxopentanoate. |
| Q: What is the LogP of ethyl 2-acetyl-4-methyl-3-oxopentanoate? |
| A: LogP of ethyl 2-acetyl-4-methyl-3-oxopentanoate is 0.97980. |
| Q: What English synonyms does ethyl 2-acetyl-4-methyl-3-oxopentanoate have? |
| A: English synonyms of ethyl 2-acetyl-4-methyl-3-oxopentanoate: 2-Isobutyryl-acetessigsaeure-ethylester, ethyl 3-oxo-2-acetyl-4-methylpentanoate, 2-acetyl-4-methyl-3-oxo-pentanoic acid ethyl ester, 2-Acetyl-4-methyl-3-oxo-valeriansaeure-aethylester, 2-acetyl-4-methyl-3-oxo-valeric acid ethyl ester. |
| Q: What are the downstream products of ethyl 2-acetyl-4-methyl-3-oxopentanoate? |
| A: Related downstream products(CAS) of ethyl 2-acetyl-4-methyl-3-oxopentanoate: 42558-54-3;563-80-4;64-17-5;64-19-7;7307-03-1;90087-36-8. |
This table lists manufacturers and suppliers of this compound, including vendor names and product supply reference information.
| Dayang Chem (Hangzhou) Co., Ltd. |