Diethyl 6,9-dihydro-4,6-dioxo-10-propyl-4H-pyrano-[3,2-g]-quinoline-2,8-dicarboxylate
Modify Date: 2026-07-19 16:17:56
![Diethyl 6,9-dihydro-4,6-dioxo-10-propyl-4H-pyrano-[3,2-g]-quinoline-2,8-dicarboxylate Structure](https://www.chemsrc.com/extcaspic/181/79324-48-4.png)
Diethyl 6,9-dihydro-4,6-dioxo-10-propyl-4H-pyrano-[3,2-g]-quinoline-2,8-dicarboxylate structure
|
Common Name | Diethyl 6,9-dihydro-4,6-dioxo-10-propyl-4H-pyrano-[3,2-g]-quinoline-2,8-dicarboxylate | ||
|---|---|---|---|---|
| CAS Number | 79324-48-4 | Molecular Weight | 399.4 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C21H21NO7 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | Diethyl 6,9-dihydro-4,6-dioxo-10-propyl-4H-pyrano-[3,2-g]-quinoline-2,8-dicarboxylate |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C21H21NO7 |
|---|---|
| Molecular Weight | 399.4 |
| InChIKey | DZXIKYRDMDEUMX-UHFFFAOYSA-N |
| SMILES | CCCc1c2[nH]c(C(=O)OCC)cc(=O)c2cc2c(=O)cc(C(=O)OCC)oc12 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the molecular weight of Diethyl 6,9-dihydro-4,6-dioxo-10-propyl-4H-pyrano-[3,2-g]-quinoline-2,8-dicarboxylate? |
| A: Molecular weight of Diethyl 6,9-dihydro-4,6-dioxo-10-propyl-4H-pyrano-[3,2-g]-quinoline-2,8-dicarboxylate is 399.4. |
| Q: What is the Chinese name of 79324-48-4? |
| A: Chinese name of 79324-48-4 is 79324-48-4. |
| Q: What is the molecular formula of Diethyl 6,9-dihydro-4,6-dioxo-10-propyl-4H-pyrano-[3,2-g]-quinoline-2,8-dicarboxylate? |
| A: Molecular formula of Diethyl 6,9-dihydro-4,6-dioxo-10-propyl-4H-pyrano-[3,2-g]-quinoline-2,8-dicarboxylate is C21H21NO7. |
| Q: What is the CAS number of Diethyl 6,9-dihydro-4,6-dioxo-10-propyl-4H-pyrano-[3,2-g]-quinoline-2,8-dicarboxylate? |
| A: CAS number of Diethyl 6,9-dihydro-4,6-dioxo-10-propyl-4H-pyrano-[3,2-g]-quinoline-2,8-dicarboxylate is 79324-48-4. |
| Q: What is the English name of Diethyl 6,9-dihydro-4,6-dioxo-10-propyl-4H-pyrano-[3,2-g]-quinoline-2,8-dicarboxylate? |
| A: The English name of Diethyl 6,9-dihydro-4,6-dioxo-10-propyl-4H-pyrano-[3,2-g]-quinoline-2,8-dicarboxylate is Diethyl 6,9-dihydro-4,6-dioxo-10-propyl-4H-pyrano-[3,2-g]-quinoline-2,8-dicarboxylate. |
| Q: What is the InChIKey of Diethyl 6,9-dihydro-4,6-dioxo-10-propyl-4H-pyrano-[3,2-g]-quinoline-2,8-dicarboxylate? |
| A: InChIKey of Diethyl 6,9-dihydro-4,6-dioxo-10-propyl-4H-pyrano-[3,2-g]-quinoline-2,8-dicarboxylate is DZXIKYRDMDEUMX-UHFFFAOYSA-N. |
| Q: What is the SMILES notation of Diethyl 6,9-dihydro-4,6-dioxo-10-propyl-4H-pyrano-[3,2-g]-quinoline-2,8-dicarboxylate? |
| A: SMILES notation of Diethyl 6,9-dihydro-4,6-dioxo-10-propyl-4H-pyrano-[3,2-g]-quinoline-2,8-dicarboxylate is CCCc1c2[nH]c(C(=O)OCC)cc(=O)c2cc2c(=O)cc(C(=O)OCC)oc12. |