2-methoxycarbonyl-2-phenylpropionitrile
2-methoxycarbonyl-2-phenylpropionitrile structure
|
Common Name | 2-methoxycarbonyl-2-phenylpropionitrile | ||
|---|---|---|---|---|
| CAS Number | 79341-72-3 | Molecular Weight | 189.21100 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C11H11NO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Summary: 2-Methoxycarbonyl-2-phenylpropionitrile (CAS: 79341-72-3), molecular formula C11H11NO2, molecular weight 189.21100, for research-use only, not for medical or clinical usage.
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 2-methoxycarbonyl-2-phenylpropionitrile |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C11H11NO2 |
|---|---|
| Molecular Weight | 189.21100 |
| Exact Mass | 189.07900 |
| PSA | 50.09000 |
| LogP | 1.64088 |
| InChIKey | WYFPWLHRPZDLMF-UHFFFAOYSA-N |
| SMILES | COC(=O)C(C)(C#N)c1ccccc1 |
This table lists upstream starting materials and downstream derivative products related to this chemical.
| Precursor 0 | |
|---|---|
| DownStream 1 | |
CAS#:1823-91-2This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| methyl 2-cyano-2-phenylpropanoate |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the molecular weight of 2-methoxycarbonyl-2-phenylpropionitrile? |
| A: Molecular weight of 2-methoxycarbonyl-2-phenylpropionitrile is 189.21100. |
| Q: What is the SMILES notation of 2-methoxycarbonyl-2-phenylpropionitrile? |
| A: SMILES notation of 2-methoxycarbonyl-2-phenylpropionitrile is COC(=O)C(C)(C#N)c1ccccc1. |
| Q: What is the polar surface area (PSA) of 2-methoxycarbonyl-2-phenylpropionitrile? |
| A: Polar surface area (PSA) of 2-methoxycarbonyl-2-phenylpropionitrile is 50.09000. |
| Q: What is the English name of 2-methoxycarbonyl-2-phenylpropionitrile? |
| A: The English name of 2-methoxycarbonyl-2-phenylpropionitrile is 2-methoxycarbonyl-2-phenylpropionitrile. |
| Q: What is the LogP of 2-methoxycarbonyl-2-phenylpropionitrile? |
| A: LogP of 2-methoxycarbonyl-2-phenylpropionitrile is 1.64088. |
| Q: What are the downstream products of 2-methoxycarbonyl-2-phenylpropionitrile? |
| A: Related downstream products(CAS) of 2-methoxycarbonyl-2-phenylpropionitrile: 1823-91-2. |
| Q: What is the Chinese name of 79341-72-3? |
| A: Chinese name of 79341-72-3 is 79341-72-3. |
| Q: What is the molecular formula of 2-methoxycarbonyl-2-phenylpropionitrile? |
| A: Molecular formula of 2-methoxycarbonyl-2-phenylpropionitrile is C11H11NO2. |
| Q: What English synonyms does 2-methoxycarbonyl-2-phenylpropionitrile have? |
| A: English synonyms of 2-methoxycarbonyl-2-phenylpropionitrile: methyl 2-cyano-2-phenylpropanoate. |
| Q: What is the InChIKey of 2-methoxycarbonyl-2-phenylpropionitrile? |
| A: InChIKey of 2-methoxycarbonyl-2-phenylpropionitrile is WYFPWLHRPZDLMF-UHFFFAOYSA-N. |