1,1-Diethyl 2-(bromomethyl)cyclopropane-1,1-dicarboxylate
Modify Date: 2026-07-15 07:55:33
1,1-Diethyl 2-(bromomethyl)cyclopropane-1,1-dicarboxylate structure
|
Common Name | 1,1-Diethyl 2-(bromomethyl)cyclopropane-1,1-dicarboxylate | ||
|---|---|---|---|---|
| CAS Number | 79357-20-3 | Molecular Weight | 279.13 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C10H15BrO4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 1,1-Diethyl 2-(bromomethyl)cyclopropane-1,1-dicarboxylate |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C10H15BrO4 |
|---|---|
| Molecular Weight | 279.13 |
| InChIKey | HSBWSMSYVIEDQU-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1(C(=O)OCC)CC1CBr |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the SMILES notation of 1,1-Diethyl 2-(bromomethyl)cyclopropane-1,1-dicarboxylate? |
| A: SMILES notation of 1,1-Diethyl 2-(bromomethyl)cyclopropane-1,1-dicarboxylate is CCOC(=O)C1(C(=O)OCC)CC1CBr. |
| Q: What is the molecular weight of 1,1-Diethyl 2-(bromomethyl)cyclopropane-1,1-dicarboxylate? |
| A: Molecular weight of 1,1-Diethyl 2-(bromomethyl)cyclopropane-1,1-dicarboxylate is 279.13. |
| Q: What is the InChIKey of 1,1-Diethyl 2-(bromomethyl)cyclopropane-1,1-dicarboxylate? |
| A: InChIKey of 1,1-Diethyl 2-(bromomethyl)cyclopropane-1,1-dicarboxylate is HSBWSMSYVIEDQU-UHFFFAOYSA-N. |
| Q: What is the molecular formula of 1,1-Diethyl 2-(bromomethyl)cyclopropane-1,1-dicarboxylate? |
| A: Molecular formula of 1,1-Diethyl 2-(bromomethyl)cyclopropane-1,1-dicarboxylate is C10H15BrO4. |
| Q: What is the Chinese name of 79357-20-3? |
| A: Chinese name of 79357-20-3 is 79357-20-3. |
| Q: What is the CAS number of 1,1-Diethyl 2-(bromomethyl)cyclopropane-1,1-dicarboxylate? |
| A: CAS number of 1,1-Diethyl 2-(bromomethyl)cyclopropane-1,1-dicarboxylate is 79357-20-3. |
| Q: What is the English name of 1,1-Diethyl 2-(bromomethyl)cyclopropane-1,1-dicarboxylate? |
| A: The English name of 1,1-Diethyl 2-(bromomethyl)cyclopropane-1,1-dicarboxylate is 1,1-Diethyl 2-(bromomethyl)cyclopropane-1,1-dicarboxylate. |