2-fluoro-5-methoxy-4-phenylmethoxybenzaldehyde structure
|
Common Name | 2-fluoro-5-methoxy-4-phenylmethoxybenzaldehyde | ||
|---|---|---|---|---|
| CAS Number | 79418-72-7 | Molecular Weight | 260.26000 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C15H13FO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 2-fluoro-5-methoxy-4-phenylmethoxybenzaldehyde |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C15H13FO3 |
|---|---|
| Molecular Weight | 260.26000 |
| Exact Mass | 260.08500 |
| PSA | 35.53000 |
| LogP | 3.22580 |
| InChIKey | OLVWVOPLCFKINL-UHFFFAOYSA-N |
| SMILES | COc1cc(C=O)c(F)cc1OCc1ccccc1 |
|
~81%
2-fluoro-5-meth... CAS#:79418-72-7 |
| Literature: PLEXXIKON, INC. Patent: WO2007/2325 A1, 2007 ; Location in patent: Page/Page column 235 ; WO 2007/002325 A1 |
|
~88%
2-fluoro-5-meth... CAS#:79418-72-7 |
| Literature: Nie, Jun-ying; Kirk, Kenneth L. Journal of Fluorine Chemistry, 1991 , vol. 55, # 3 p. 259 - 269 |
|
~%
2-fluoro-5-meth... CAS#:79418-72-7 |
| Literature: Nie, Jun-ying; Kirk, Kenneth L. Journal of Fluorine Chemistry, 1991 , vol. 55, # 3 p. 259 - 269 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |
| 4-Benzyloxy-2-fluoro-5-methoxybenzaldehyde |
| Benzaldehyde,4-benzyloxy-2-fluoro-5-methoxy |
| Benzaldehyde,2-fluoro-5-methoxy-4-(phenylmethoxy) |