acetic acid,6-chloro-3,7-dimethylocta-1,7-dien-3-ol
acetic acid,6-chloro-3,7-dimethylocta-1,7-dien-3-ol structure
|
Common Name | acetic acid,6-chloro-3,7-dimethylocta-1,7-dien-3-ol | ||
|---|---|---|---|---|
| CAS Number | 79421-89-9 | Molecular Weight | 248.74600 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C12H21ClO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | acetic acid,6-chloro-3,7-dimethylocta-1,7-dien-3-ol |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C12H21ClO3 |
|---|---|
| Molecular Weight | 248.74600 |
| Exact Mass | 248.11800 |
| PSA | 57.53000 |
| LogP | 2.97800 |
| InChIKey | HFIWTJCVGDAENF-UHFFFAOYSA-N |
| SMILES | C=CC(C)(O)CCC(Cl)C(=C)C.CC(=O)O |
This table presents publicly reported synthetic routes, reaction conditions, reactants and product information of the compound.
|
~92%
acetic acid,6-c... CAS#:79421-89-9 |
| Literature: Torii, Sigeru; Uneyama, Kenji; Nakai, Toshiyuki; Yasuda, Tsuneo Tetrahedron Letters, 1981 , vol. 22, # 24 p. 2291 - 2294 |
|
~%
acetic acid,6-c... CAS#:79421-89-9 |
| Literature: Fritzsche Dodge and Olcott Inc. Patent: US4510319 A1, 1985 ; |
This table lists upstream starting materials and downstream derivative products related to this chemical.
| Precursor 2 | |
|---|---|
| DownStream 1 | |
CAS#:1611-21-8This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| 3-acetoxy-6-chloro-3,7-dimethyl-1,7-octadiene |
| 1,7-Octadien-3-ol,6-chloro-3,7-dimethyl-,acetate |
| 3-acetoxy-3,7-dimethyl-6-chloro-1,7-octadiene |
| 6-chloro-7-methylene-3-methyl-1-octen-3-yl acetate |
| 6-chloro-3,7-dimethyl-1,7-octadien-3-yl acetate |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the SMILES notation of acetic acid,6-chloro-3,7-dimethylocta-1,7-dien-3-ol? |
| A: SMILES notation of acetic acid,6-chloro-3,7-dimethylocta-1,7-dien-3-ol is C=CC(C)(O)CCC(Cl)C(=C)C.CC(=O)O. |
| Q: What is the CAS number of acetic acid,6-chloro-3,7-dimethylocta-1,7-dien-3-ol? |
| A: CAS number of acetic acid,6-chloro-3,7-dimethylocta-1,7-dien-3-ol is 79421-89-9. |
| Q: What are the downstream products of acetic acid,6-chloro-3,7-dimethylocta-1,7-dien-3-ol? |
| A: Related downstream products(CAS) of acetic acid,6-chloro-3,7-dimethylocta-1,7-dien-3-ol: 1611-21-8. |
| Q: What is the InChIKey of acetic acid,6-chloro-3,7-dimethylocta-1,7-dien-3-ol? |
| A: InChIKey of acetic acid,6-chloro-3,7-dimethylocta-1,7-dien-3-ol is HFIWTJCVGDAENF-UHFFFAOYSA-N. |
| Q: What English synonyms does acetic acid,6-chloro-3,7-dimethylocta-1,7-dien-3-ol have? |
| A: English synonyms of acetic acid,6-chloro-3,7-dimethylocta-1,7-dien-3-ol: 3-acetoxy-6-chloro-3,7-dimethyl-1,7-octadiene, 1,7-Octadien-3-ol,6-chloro-3,7-dimethyl-,acetate, 3-acetoxy-3,7-dimethyl-6-chloro-1,7-octadiene, 6-chloro-7-methylene-3-methyl-1-octen-3-yl acetate, 6-chloro-3,7-dimethyl-1,7-octadien-3-yl acetate. |
| Q: What is the Chinese name of 79421-89-9? |
| A: Chinese name of 79421-89-9 is 79421-89-9. |
| Q: What is the polar surface area (PSA) of acetic acid,6-chloro-3,7-dimethylocta-1,7-dien-3-ol? |
| A: Polar surface area (PSA) of acetic acid,6-chloro-3,7-dimethylocta-1,7-dien-3-ol is 57.53000. |
| Q: What is the molecular weight of acetic acid,6-chloro-3,7-dimethylocta-1,7-dien-3-ol? |
| A: Molecular weight of acetic acid,6-chloro-3,7-dimethylocta-1,7-dien-3-ol is 248.74600. |
| Q: What is the LogP of acetic acid,6-chloro-3,7-dimethylocta-1,7-dien-3-ol? |
| A: LogP of acetic acid,6-chloro-3,7-dimethylocta-1,7-dien-3-ol is 2.97800. |
| Q: What are the upstream materials of acetic acid,6-chloro-3,7-dimethylocta-1,7-dien-3-ol? |
| A: Related upstream materials(CAS) of acetic acid,6-chloro-3,7-dimethylocta-1,7-dien-3-ol: 115-95-7;7778-54-3. |