Pyrazolo[5,1-c][1,2,4]triazine,4-(4-methoxyphenyl)-8-[3-(trifluoromethyl)phenyl]
Modify Date: 2025-09-29 12:50:20
![Pyrazolo[5,1-c][1,2,4]triazine,4-(4-methoxyphenyl)-8-[3-(trifluoromethyl)phenyl] Structure](https://image.chemsrc.com/caspic/278/79441-93-3.png)
Pyrazolo[5,1-c][1,2,4]triazine,4-(4-methoxyphenyl)-8-[3-(trifluoromethyl)phenyl] structure
|
Common Name | Pyrazolo[5,1-c][1,2,4]triazine,4-(4-methoxyphenyl)-8-[3-(trifluoromethyl)phenyl] | ||
|---|---|---|---|---|
| CAS Number | 79441-93-3 | Molecular Weight | 370.32800 | |
| Density | 1.37g/cm3 | Boiling Point | N/A | |
| Molecular Formula | C19H13F3N4O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 4-(4-methoxyphenyl)-8-[3-(trifluoromethyl)phenyl]pyrazolo[5,1-c][1,2,4]triazine |
|---|
| Density | 1.37g/cm3 |
|---|---|
| Molecular Formula | C19H13F3N4O |
| Molecular Weight | 370.32800 |
| Exact Mass | 370.10400 |
| PSA | 52.31000 |
| LogP | 4.48570 |
| Index of Refraction | 1.619 |
| InChIKey | SBJCTTSCLDWRDY-UHFFFAOYSA-N |
| SMILES | COc1ccc(-c2cnnc3c(-c4cccc(C(F)(F)F)c4)cnn23)cc1 |
|
~%
Pyrazolo[5,1-c]... CAS#:79441-93-3 |
| Literature: Ege, Guenter; Gilbert, Karlheinz Journal of Heterocyclic Chemistry, 1981 , vol. 18, p. 675 - 677 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
|
Name: NCI human tumor cell line growth inhibition assay. Data for the MCF7 Non-Small Cell L...
Source: DTP/NCI
Target: N/A
External Id: MCF7_OneDose
|
|
Name: NCI human tumor cell line growth inhibition assay. Data for the IGROV1 Non-Small Cell...
Source: DTP/NCI
Target: N/A
External Id: IGROV1_OneDose
|
Total 2, Current Page 1 of 1
1