2-chloro-3-(chloromethyl)-7,8-dimethylquinoline structure
|
Common Name | 2-chloro-3-(chloromethyl)-7,8-dimethylquinoline | ||
|---|---|---|---|---|
| CAS Number | 794582-35-7 | Molecular Weight | 240.12800 | |
| Density | 1.27g/cm3 | Boiling Point | 369.1ºC at 760 mmHg | |
| Molecular Formula | C12H11Cl2N | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 208.6ºC | |
| Name | 2-chloro-3-(chloromethyl)-7,8-dimethylquinoline |
|---|---|
| Synonym | More Synonyms |
| Density | 1.27g/cm3 |
|---|---|
| Boiling Point | 369.1ºC at 760 mmHg |
| Molecular Formula | C12H11Cl2N |
| Molecular Weight | 240.12800 |
| Flash Point | 208.6ºC |
| Exact Mass | 239.02700 |
| PSA | 12.89000 |
| LogP | 4.24380 |
| Index of Refraction | 1.621 |
| InChIKey | WGNBVVFJVKLVHH-UHFFFAOYSA-N |
| SMILES | Cc1ccc2cc(CCl)c(Cl)nc2c1C |
| HS Code | 2933499090 |
|---|
| HS Code | 2933499090 |
|---|---|
| Summary | 2933499090. other compounds containing in the structure a quinoline or isoquinoline ring-system (whether or not hydrogenated), not further fused. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| MFCD06368066 |