2-benzoyl-3-methylcyclohex-2-en-1-one
2-benzoyl-3-methylcyclohex-2-en-1-one structure
|
Common Name | 2-benzoyl-3-methylcyclohex-2-en-1-one | ||
|---|---|---|---|---|
| CAS Number | 79482-22-7 | Molecular Weight | 214.26000 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C14H14O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Summary: 2-Benzoyl-3-methylcyclohex-2-en-1-one (CAS: 79482-22-7), molecular formula C14H14O2, molecular weight 214.26. For research-use only, not for medical or clinical usage.
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 2-benzoyl-3-methylcyclohex-2-en-1-one |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C14H14O2 |
|---|---|
| Molecular Weight | 214.26000 |
| Exact Mass | 214.09900 |
| PSA | 34.14000 |
| LogP | 2.93880 |
| InChIKey | ZMAKFNRWPIFJRQ-UHFFFAOYSA-N |
| SMILES | CC1=C(C(=O)c2ccccc2)C(=O)CCC1 |
This table presents publicly reported synthetic routes, reaction conditions, reactants and product information of the compound.
This table lists upstream starting materials and downstream derivative products related to this chemical.
| Precursor 9 | |
|---|---|
| DownStream 0 | |
CAS#:131223-44-4
CAS#:79482-32-9
CAS#:1193-18-6
CAS#:98-88-4
CAS#:66049-39-6
CAS#:69629-50-1
CAS#:504-02-9
CAS#:71808-96-3
CAS#:79482-26-1This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| 2-benzoyl-3-methylcyclohex-2-enone |
| 2-benzoyl-3-methyl-2-cyclohexenone |
| 2-Cyclohexen-1-one,2-benzoyl-3-methyl |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the InChIKey of 2-benzoyl-3-methylcyclohex-2-en-1-one? |
| A: InChIKey of 2-benzoyl-3-methylcyclohex-2-en-1-one is ZMAKFNRWPIFJRQ-UHFFFAOYSA-N. |
| Q: What is the molecular weight of 2-benzoyl-3-methylcyclohex-2-en-1-one? |
| A: Molecular weight of 2-benzoyl-3-methylcyclohex-2-en-1-one is 214.26000. |
| Q: What is the English name of 2-benzoyl-3-methylcyclohex-2-en-1-one? |
| A: The English name of 2-benzoyl-3-methylcyclohex-2-en-1-one is 2-benzoyl-3-methylcyclohex-2-en-1-one. |
| Q: What is the molecular formula of 2-benzoyl-3-methylcyclohex-2-en-1-one? |
| A: Molecular formula of 2-benzoyl-3-methylcyclohex-2-en-1-one is C14H14O2. |
| Q: What is the SMILES notation of 2-benzoyl-3-methylcyclohex-2-en-1-one? |
| A: SMILES notation of 2-benzoyl-3-methylcyclohex-2-en-1-one is CC1=C(C(=O)c2ccccc2)C(=O)CCC1. |
| Q: What is the polar surface area (PSA) of 2-benzoyl-3-methylcyclohex-2-en-1-one? |
| A: Polar surface area (PSA) of 2-benzoyl-3-methylcyclohex-2-en-1-one is 34.14000. |
| Q: What is the LogP of 2-benzoyl-3-methylcyclohex-2-en-1-one? |
| A: LogP of 2-benzoyl-3-methylcyclohex-2-en-1-one is 2.93880. |
| Q: What is the Chinese name of 79482-22-7? |
| A: Chinese name of 79482-22-7 is 79482-22-7. |
| Q: What is the CAS number of 2-benzoyl-3-methylcyclohex-2-en-1-one? |
| A: CAS number of 2-benzoyl-3-methylcyclohex-2-en-1-one is 79482-22-7. |
| Q: What are the upstream materials of 2-benzoyl-3-methylcyclohex-2-en-1-one? |
| A: Related upstream materials(CAS) of 2-benzoyl-3-methylcyclohex-2-en-1-one: 131223-44-4;79482-32-9;1193-18-6;98-88-4;66049-39-6;69629-50-1;504-02-9;71808-96-3;79482-26-1. |