4-(4-Nitrophenyl)-1-butanol structure
|
Common Name | 4-(4-Nitrophenyl)-1-butanol | ||
|---|---|---|---|---|
| CAS Number | 79524-20-2 | Molecular Weight | 195.21500 | |
| Density | 1.154 g/mL at 25ºC(lit.) | Boiling Point | 356.2ºC at 760 mmHg | |
| Molecular Formula | C10H13NO3 | Melting Point | N/A | |
| MSDS | USA | Flash Point | >230 °F | |
| Name | 4-(4-nitrophenyl)butan-1-ol |
|---|---|
| Synonym | More Synonyms |
| Density | 1.154 g/mL at 25ºC(lit.) |
|---|---|
| Boiling Point | 356.2ºC at 760 mmHg |
| Molecular Formula | C10H13NO3 |
| Molecular Weight | 195.21500 |
| Flash Point | >230 °F |
| Exact Mass | 195.09000 |
| PSA | 66.05000 |
| LogP | 2.43300 |
| Index of Refraction | n20/D 1.557(lit.) |
| InChIKey | MFYJBAQONVFIFC-UHFFFAOYSA-N |
| SMILES | O=[N+]([O-])c1ccc(CCCCO)cc1 |
| RIDADR | NONH for all modes of transport |
|---|
|
~98%
4-(4-Nitropheny... CAS#:79524-20-2 |
| Literature: Zou; Kopajtic; Katz; Wirtz; Justice Jr.; Newman Journal of Medicinal Chemistry, 2001 , vol. 44, # 25 p. 4453 - 4461 |
| Precursor 1 | |
|---|---|
| DownStream 2 | |
|
Chemoenzymatic synthesis of the Salmonella group E1 core trisaccharide using a recombinant beta-(1-->4)-mannosyltransferase.
Carbohydr. Res. 319(1-4) , 184-91, (1999) The chemical synthesis of the bacterial O-antigen from Salmonella serogroup E1, 3-O-(4-O-beta-D-mannopyranosyl-alpha-L-rhamnopyranosyl)-alpha-D-galactos e, presents a particular challenge because it c... |
| Benzenebutanol,4-nitro |
| 4-(4-nitrophenyl)-butanol |
| 4-(p-nitrophenyl)butanol |
| EINECS 279-175-2 |
| 4-(4-nitrophenyl)-butan-1-ol |
| 4-(4-Nitrophenyl)-1-butanol |
| MFCD00007388 |