3-(4-chlorophenyl)-N-methyl-3-pyridin-3-ylprop-2-en-1-amine structure
|
Common Name | 3-(4-chlorophenyl)-N-methyl-3-pyridin-3-ylprop-2-en-1-amine | ||
|---|---|---|---|---|
| CAS Number | 79568-10-8 | Molecular Weight | 258.74600 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C15H15ClN2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 3-(4-chlorophenyl)-N-methyl-3-pyridin-3-ylprop-2-en-1-amine |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C15H15ClN2 |
|---|---|
| Molecular Weight | 258.74600 |
| Exact Mass | 258.09200 |
| PSA | 24.92000 |
| LogP | 3.77700 |
| InChIKey | IJBZBGVEDKSOHI-UHFFFAOYSA-N |
| SMILES | CNCC=C(c1ccc(Cl)cc1)c1cccnc1 |
|
~%
3-(4-chlorophen... CAS#:79568-10-8 |
| Literature: Hogberg; Ulff; Renyi; Ross Journal of Medicinal Chemistry, 1981 , vol. 24, # 12 p. 1499 - 1507 |
|
~%
3-(4-chlorophen... CAS#:79568-10-8 |
| Literature: Hogberg; Ulff; Renyi; Ross Journal of Medicinal Chemistry, 1981 , vol. 24, # 12 p. 1499 - 1507 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |
| 2-Propen-1-amine,3-(4-chlorophenyl)-N-methyl-3-(3-pyridinyl) |