N-(2-methoxyphenyl)-4-(5-nitro-2-furyl)-1,3-thiazol-2-amine structure
|
Common Name | N-(2-methoxyphenyl)-4-(5-nitro-2-furyl)-1,3-thiazol-2-amine | ||
|---|---|---|---|---|
| CAS Number | 79571-44-1 | Molecular Weight | 317.32000 | |
| Density | 1.428g/cm3 | Boiling Point | 501ºC at 760 mmHg | |
| Molecular Formula | C14H11N3O4S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 256.8ºC | |
| Name | N-(2-methoxyphenyl)-4-(5-nitrofuran-2-yl)-1,3-thiazol-2-amine |
|---|
| Density | 1.428g/cm3 |
|---|---|
| Boiling Point | 501ºC at 760 mmHg |
| Molecular Formula | C14H11N3O4S |
| Molecular Weight | 317.32000 |
| Flash Point | 256.8ºC |
| Exact Mass | 317.04700 |
| PSA | 121.35000 |
| LogP | 4.65970 |
| Index of Refraction | 1.662 |
| InChIKey | JEJYRYMGASNUHY-UHFFFAOYSA-N |
| SMILES | COc1ccccc1Nc1nc(-c2ccc([N+](=O)[O-])o2)cs1 |
|
~%
N-(2-methoxyphe... CAS#:79571-44-1 |
| Literature: Khadse, B. G.; Lokhande, S. R.; Kulkarni, D. G. Indian Journal of Chemistry, Section B: Organic Chemistry Including Medicinal Chemistry, 1981 , vol. 20, # 8 p. 683 - 685 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |