ethyl 4-[(2-hydroxy-2,3-dihydro-1H-inden-1-yl)amino]benzoate structure
|
Common Name | ethyl 4-[(2-hydroxy-2,3-dihydro-1H-inden-1-yl)amino]benzoate | ||
|---|---|---|---|---|
| CAS Number | 796-56-5 | Molecular Weight | 297.34800 | |
| Density | 1.266g/cm3 | Boiling Point | 492.2ºC at 760 mmHg | |
| Molecular Formula | C18H19NO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 251.5ºC | |
| Name | ethyl 4-[(2-hydroxy-2,3-dihydro-1H-inden-1-yl)amino]benzoate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.266g/cm3 |
|---|---|
| Boiling Point | 492.2ºC at 760 mmHg |
| Molecular Formula | C18H19NO3 |
| Molecular Weight | 297.34800 |
| Flash Point | 251.5ºC |
| Exact Mass | 297.13600 |
| PSA | 58.56000 |
| LogP | 3.00650 |
| Index of Refraction | 1.649 |
| InChIKey | WLHGXQZYXMLCOG-UHFFFAOYSA-N |
| SMILES | CCOC(=O)c1ccc(NC2c3ccccc3CC2O)cc1 |
|
~%
ethyl 4-[(2-hyd... CAS#:796-56-5 |
| Literature: Sam,J.; Snapp,T.C. Journal of Pharmaceutical Sciences, 1964 , vol. 53, p. 1364 - 1367 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| 4-<2-Hydroxy-indanyl-(1)-amino>-benzoesaeure-aethylester |