3-(3-chloro-4-phenylmethoxyphenyl)propanoic acid structure
|
Common Name | 3-(3-chloro-4-phenylmethoxyphenyl)propanoic acid | ||
|---|---|---|---|---|
| CAS Number | 79669-13-9 | Molecular Weight | 290.74200 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C16H15ClO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 3-(3-chloro-4-phenylmethoxyphenyl)propanoic acid |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C16H15ClO3 |
|---|---|
| Molecular Weight | 290.74200 |
| Exact Mass | 290.07100 |
| PSA | 46.53000 |
| LogP | 3.93620 |
| InChIKey | DZYUXEQPUIHQEY-UHFFFAOYSA-N |
| SMILES | O=C(O)CCc1ccc(OCc2ccccc2)c(Cl)c1 |
|
~%
3-(3-chloro-4-p... CAS#:79669-13-9 |
| Literature: Kuchar, Miroslav; Brunova, Bohumila; Rejholec, Vaclav; Roubal, Zdenek; Nemecek, Oldrich Collection of Czechoslovak Chemical Communications, 1981 , vol. 46, # 5 p. 1173 - 1187 |
|
~%
3-(3-chloro-4-p... CAS#:79669-13-9 |
| Literature: Kuchar; Rejholec; Brunova; et al. Collection of Czechoslovak Chemical Communications, 1982 , vol. 47, # 9 p. 2514 - 2524 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| 3-[4-(benzyloxy)-3-chlorophenyl]propanoic acid |
| Benzenepropanoic acid,3-chloro-4-(phenylmethoxy) |