20beta-Hydroxy-1-oxo-(22R)-witha-2,5,24-trienolide structure
|
Common Name | 20beta-Hydroxy-1-oxo-(22R)-witha-2,5,24-trienolide | ||
|---|---|---|---|---|
| CAS Number | 79684-01-8 | Molecular Weight | 438.6 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C28H38O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 20beta-Hydroxy-1-oxo-(22R)-witha-2,5,24-trienolide |
|---|
| Molecular Formula | C28H38O4 |
|---|---|
| Molecular Weight | 438.6 |
| InChIKey | VOFPJACKXWOYES-ZJOYFJNASA-N |
| SMILES | CC1=C(C(=O)O[C@H](C1)[C@@](C)([C@H]2CC[C@@H]3[C@@]2(CC[C@H]4[C@H]3CC=C5[C@@]4(C(=O)C=CC5)C)C)O)C |
|
Name: Inhibition of Saccharomyces sp. alpha-glucosidase using p-nitrophenyl a-D-glucopyrano...
Source: ChEMBL
Target: N/A
External Id: CHEMBL2427955
|
|
Name: Inhibition of Saccharomyces sp. alpha-glucosidase using p-nitrophenyl a-D-glucopyrano...
Source: ChEMBL
Target: N/A
External Id: CHEMBL2427954
|