kt-1 (from kyoto university)
kt-1 (from kyoto university) structure
|
Common Name | kt-1 (from kyoto university) | ||
|---|---|---|---|---|
| CAS Number | 79729-75-2 | Molecular Weight | 468.53900 | |
| Density | 1.39g/cm3 | Boiling Point | 657.5ºC at 760 mmHg | |
| Molecular Formula | C27H32O7 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 221.2ºC | |
Summary: kt-1 (from kyoto university)，CAS number 79729-75-2，molecular formula C27H32O7，molecular weight 468.53900。For research-use only, not for medical or clinical usage.
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | kt-1 (from kyoto university) |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Density | 1.39g/cm3 |
|---|---|
| Boiling Point | 657.5ºC at 760 mmHg |
| Molecular Formula | C27H32O7 |
| Molecular Weight | 468.53900 |
| Flash Point | 221.2ºC |
| Exact Mass | 468.21500 |
| PSA | 113.29000 |
| LogP | 2.24030 |
| Index of Refraction | 1.641 |
| InChIKey | DWISOLDFCILETQ-UHFFFAOYSA-N |
| SMILES | C=C1C(=O)C23C(OC(=O)c4ccccc4)C1CCC2C12COC3(O)C(O)C1C(C)(C)CCC2O |
This table presents publicly reported synthetic routes, reaction conditions, reactants and product information of the compound.
|
~75%
kt-1 (from kyot... CAS#:79729-75-2 |
| Literature: Fujita; Nagao; Kohno; Matsuda; Ozaki Chemical and Pharmaceutical Bulletin, 1981 , vol. 29, # 11 p. 3208 - 3213 |
This table lists upstream starting materials and downstream derivative products related to this chemical.
| Precursor 2 | |
|---|---|
| DownStream 0 | |
This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| 14-O-benzoyloridonin |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the molecular formula of kt-1 (from kyoto university)? |
| A: Molecular formula of kt-1 (from kyoto university) is C27H32O7. |
| Q: What is the English name of kt-1 (from kyoto university)? |
| A: The English name of kt-1 (from kyoto university) is kt-1 (from kyoto university). |
| Q: What is the Chinese name of 79729-75-2? |
| A: Chinese name of 79729-75-2 is 79729-75-2. |
| Q: What is the molecular weight of kt-1 (from kyoto university)? |
| A: Molecular weight of kt-1 (from kyoto university) is 468.53900. |
| Q: What is the SMILES notation of kt-1 (from kyoto university)? |
| A: SMILES notation of kt-1 (from kyoto university) is C=C1C(=O)C23C(OC(=O)c4ccccc4)C1CCC2C12COC3(O)C(O)C1C(C)(C)CCC2O. |
| Q: What is the boiling point of kt-1 (from kyoto university)? |
| A: Boiling point of kt-1 (from kyoto university) is 657.5ºC at 760 mmHg. |
| Q: What is the LogP of kt-1 (from kyoto university)? |
| A: LogP of kt-1 (from kyoto university) is 2.24030. |
| Q: What are the upstream materials of kt-1 (from kyoto university)? |
| A: Related upstream materials(CAS) of kt-1 (from kyoto university): 98-88-4;28957-04-2. |
| Q: What is the InChIKey of kt-1 (from kyoto university)? |
| A: InChIKey of kt-1 (from kyoto university) is DWISOLDFCILETQ-UHFFFAOYSA-N. |
| Q: What English synonyms does kt-1 (from kyoto university) have? |
| A: English synonyms of kt-1 (from kyoto university): 14-O-benzoyloridonin. |