4-hydroxy-6-methyl-1-(4-methylphenyl)naphthalene-2,3-dicarbonitrile structure
|
Common Name | 4-hydroxy-6-methyl-1-(4-methylphenyl)naphthalene-2,3-dicarbonitrile | ||
|---|---|---|---|---|
| CAS Number | 79781-51-4 | Molecular Weight | 298.33800 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C20H14N2O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 4-hydroxy-6-methyl-1-(4-methylphenyl)naphthalene-2,3-dicarbonitrile |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C20H14N2O |
|---|---|
| Molecular Weight | 298.33800 |
| Exact Mass | 298.11100 |
| PSA | 67.81000 |
| LogP | 4.57256 |
| InChIKey | NZSYDCWFTWZLKO-UHFFFAOYSA-N |
| SMILES | Cc1ccc(-c2c(C#N)c(C#N)c(O)c3cc(C)ccc23)cc1 |
|
~82%
4-hydroxy-6-met... CAS#:79781-51-4 |
| Literature: Krepelka, Jiri; Vancurova, Iva; Holubek, Jiri Collection of Czechoslovak Chemical Communications, 1981 , vol. 46, # 6 p. 1523 - 1529 |
|
~%
4-hydroxy-6-met... CAS#:79781-51-4 |
| Literature: Krepelka, Jiri; Vancurova, Iva; Holubek, Jiri Collection of Czechoslovak Chemical Communications, 1981 , vol. 46, # 6 p. 1523 - 1529 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| 2,3-Naphthalenedicarbonitrile,4-hydroxy-6-methyl-1-(4-methylphenyl) |