N-[4-[[(4-chloro-3-nitrophenyl)sulphonyl]amino]phenyl]acetamide structure
|
Common Name | N-[4-[[(4-chloro-3-nitrophenyl)sulphonyl]amino]phenyl]acetamide | ||
|---|---|---|---|---|
| CAS Number | 79817-49-5 | Molecular Weight | 369.78000 | |
| Density | 1.57g/cm3 | Boiling Point | N/A | |
| Molecular Formula | C14H12ClN3O5S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | N-[4-[(4-chloro-3-nitrophenyl)sulfonylamino]phenyl]acetamide |
|---|---|
| Synonym | More Synonyms |
| Density | 1.57g/cm3 |
|---|---|
| Molecular Formula | C14H12ClN3O5S |
| Molecular Weight | 369.78000 |
| Exact Mass | 369.01900 |
| PSA | 132.96000 |
| LogP | 5.33390 |
| Index of Refraction | 1.668 |
| InChIKey | FAGBGCWSFWSOHI-UHFFFAOYSA-N |
| SMILES | CC(=O)Nc1ccc(NS(=O)(=O)c2ccc(Cl)c([N+](=O)[O-])c2)cc1 |
|
~%
N-[4-[[(4-chlor... CAS#:79817-49-5 |
| Literature: Allen; Bell; Wilson Journal of the American Chemical Society, 1944 , vol. 66, p. 835 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| Essigsaeure-[4-(4-chlor-3-nitro-benzol-sulfonyl-(1)-amino)-anilid] |
| N-(4-{[(4-chloro-3-nitrophenyl)sulfonyl]amino}phenyl)acetamide |
| N-[4-[[(4-chloro-3-nitrophenyl)sulphonyl]amino]phenyl]acetamide |
| N'-(4-Chlor-3-nitro-benzol-sulfonyl-(1))-N-acetyl-p-phenylendiamin |
| 1-Acetylamino-4-(4-chlor-3-nitro-benzolsulfonylamino)-benzol |
| 1-acetylamino-4-(4-chloro-3-nitro-benzenesulfonylamino)-benzene |
| 3-Nitro-4-Chloro-4'-Acetamido Benzene Sulfonamide |