dipotassium,5-amino-4-hydroxybenzene-1,3-disulfonate
Modify Date: 2026-07-15 17:26:20
dipotassium,5-amino-4-hydroxybenzene-1,3-disulfonate structure
|
Common Name | dipotassium,5-amino-4-hydroxybenzene-1,3-disulfonate | ||
|---|---|---|---|---|
| CAS Number | 79817-61-1 | Molecular Weight | 345.433 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C6H5K2NO7S2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | dipotassium,5-amino-4-hydroxybenzene-1,3-disulfonate |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C6H5K2NO7S2 |
|---|---|
| Molecular Weight | 345.433 |
| Exact Mass | 344.878143 |
| PSA | 177.41000 |
| LogP | 1.52540 |
| InChIKey | HVGAJEQHFLNKAE-UHFFFAOYSA-L |
| SMILES | Nc1cc(S(=O)(=O)[O-])cc(S(=O)(=O)[O-])c1O.[K+].[K+] |
This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| Dipotassium 5-amino-4-hydroxy-1,3-benzenedisulfonate |
| Dipotassium 5-amino-4-hydroxybenzene-1,3-disulphonate |
| 2-AMINOPHENOL-4,6-DISULFONIC ACID POTASSIUM SALT |
| 1,3-Benzenedisulfonic acid, 5-amino-4-hydroxy-, potassium salt (1:2) |
| EINECS 279-291-3 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the CAS number of dipotassium,5-amino-4-hydroxybenzene-1,3-disulfonate? |
| A: CAS number of dipotassium,5-amino-4-hydroxybenzene-1,3-disulfonate is 79817-61-1. |
| Q: What is the molecular weight of dipotassium,5-amino-4-hydroxybenzene-1,3-disulfonate? |
| A: Molecular weight of dipotassium,5-amino-4-hydroxybenzene-1,3-disulfonate is 345.433. |
| Q: What is the InChIKey of dipotassium,5-amino-4-hydroxybenzene-1,3-disulfonate? |
| A: InChIKey of dipotassium,5-amino-4-hydroxybenzene-1,3-disulfonate is HVGAJEQHFLNKAE-UHFFFAOYSA-L. |
| Q: What is the polar surface area (PSA) of dipotassium,5-amino-4-hydroxybenzene-1,3-disulfonate? |
| A: Polar surface area (PSA) of dipotassium,5-amino-4-hydroxybenzene-1,3-disulfonate is 177.41000. |
| Q: What is the SMILES notation of dipotassium,5-amino-4-hydroxybenzene-1,3-disulfonate? |
| A: SMILES notation of dipotassium,5-amino-4-hydroxybenzene-1,3-disulfonate is Nc1cc(S(=O)(=O)[O-])cc(S(=O)(=O)[O-])c1O.[K+].[K+]. |
| Q: What English synonyms does dipotassium,5-amino-4-hydroxybenzene-1,3-disulfonate have? |
| A: English synonyms of dipotassium,5-amino-4-hydroxybenzene-1,3-disulfonate: Dipotassium 5-amino-4-hydroxy-1,3-benzenedisulfonate, Dipotassium 5-amino-4-hydroxybenzene-1,3-disulphonate, 2-AMINOPHENOL-4,6-DISULFONIC ACID POTASSIUM SALT, 1,3-Benzenedisulfonic acid, 5-amino-4-hydroxy-, potassium salt (1:2), EINECS 279-291-3. |
| Q: What is the English name of dipotassium,5-amino-4-hydroxybenzene-1,3-disulfonate? |
| A: The English name of dipotassium,5-amino-4-hydroxybenzene-1,3-disulfonate is dipotassium,5-amino-4-hydroxybenzene-1,3-disulfonate. |
| Q: What is the LogP of dipotassium,5-amino-4-hydroxybenzene-1,3-disulfonate? |
| A: LogP of dipotassium,5-amino-4-hydroxybenzene-1,3-disulfonate is 1.52540. |
| Q: What is the molecular formula of dipotassium,5-amino-4-hydroxybenzene-1,3-disulfonate? |
| A: Molecular formula of dipotassium,5-amino-4-hydroxybenzene-1,3-disulfonate is C6H5K2NO7S2. |