[3,3-bis(4-methoxyphenyl)-2-phenylthiiran-2-yl]-trimethylsilane structure
|
Common Name | [3,3-bis(4-methoxyphenyl)-2-phenylthiiran-2-yl]-trimethylsilane | ||
|---|---|---|---|---|
| CAS Number | 79841-59-1 | Molecular Weight | 420.63900 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C25H28O2SSi | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | [3,3-bis(4-methoxyphenyl)-2-phenylthiiran-2-yl]-trimethylsilane |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C25H28O2SSi |
|---|---|
| Molecular Weight | 420.63900 |
| Exact Mass | 420.15800 |
| PSA | 43.76000 |
| LogP | 6.77860 |
| InChIKey | AJTHCWOJQSTLHB-UHFFFAOYSA-N |
| SMILES | COc1ccc(C2(c3ccc(OC)cc3)SC2(c2ccccc2)[Si](C)(C)C)cc1 |
|
~57%
[3,3-bis(4-meth... CAS#:79841-59-1 |
| Literature: Barbaro, Gaetano; Battaglia, Arturo; Giorgianni, Patrizia; Maccagnani, Gaetano; Macciantelli, Dante; et al. Journal of the Chemical Society, Perkin Transactions 1: Organic and Bio-Organic Chemistry (1972-1999), 1986 , p. 381 - 386 |
| Silane,[3,3-bis(4-methoxyphenyl)-2-phenylthiiranyl]trimethyl |