2,2-Bis[4-(4-maleimidophenoxy)phenyl]propane
![2,2-Bis[4-(4-maleimidophenoxy)phenyl]propane Structure](https://image.chemsrc.com/caspic/208/79922-55-7.png)
2,2-Bis[4-(4-maleimidophenoxy)phenyl]propane structure
|
Common Name | 2,2-Bis[4-(4-maleimidophenoxy)phenyl]propane | ||
|---|---|---|---|---|
| CAS Number | 79922-55-7 | Molecular Weight | 570.59100 | |
| Density | 1.34g/cm3 | Boiling Point | 729.2ºC at 760 mmHg | |
| Molecular Formula | C35H26N2O6 | Melting Point | 165° C | |
| MSDS | N/A | Flash Point | 394.8ºC | |
Summary: 2,2-Bis[4-(4-maleimidophenoxy)phenyl]propane (common name: 2,2-双[4-(4-马来酰亚胺苯氧基)苯基]丙烷)，CAS number: 79922-55-7，molecular formula: C35H26N2O6，molecular weight: 570.59100。Appearance: faint yellow to yellow crystals or powder，melting point: 165°C。For research-use only, not for medical or clinical usage.
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 1-[4-[4-[2-[4-[4-(2,5-dioxopyrrol-1-yl)phenoxy]phenyl]propan-2-yl]phenoxy]phenyl]pyrrole-2,5-dione |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Density | 1.34g/cm3 |
|---|---|
| Boiling Point | 729.2ºC at 760 mmHg |
| Melting Point | 165° C |
| Molecular Formula | C35H26N2O6 |
| Molecular Weight | 570.59100 |
| Flash Point | 394.8ºC |
| Exact Mass | 570.17900 |
| PSA | 93.22000 |
| LogP | 6.58590 |
| Index of Refraction | 1.661 |
| InChIKey | XAZPKEBWNIUCKF-UHFFFAOYSA-N |
| SMILES | CC(C)(c1ccc(Oc2ccc(N3C(=O)C=CC3=O)cc2)cc1)c1ccc(Oc2ccc(N3C(=O)C=CC3=O)cc2)cc1 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the CAS number of 1-[4-[4-[2-[4-[4-(2,5-dioxopyrrol-1-yl)phenoxy]phenyl]propan-2-yl]phenoxy]phenyl]pyrrole-2,5-dione? |
| A: CAS number of 1-[4-[4-[2-[4-[4-(2,5-dioxopyrrol-1-yl)phenoxy]phenyl]propan-2-yl]phenoxy]phenyl]pyrrole-2,5-dione is 79922-55-7. |
| Q: What is the boiling point of 1-[4-[4-[2-[4-[4-(2,5-dioxopyrrol-1-yl)phenoxy]phenyl]propan-2-yl]phenoxy]phenyl]pyrrole-2,5-dione? |
| A: Boiling point of 1-[4-[4-[2-[4-[4-(2,5-dioxopyrrol-1-yl)phenoxy]phenyl]propan-2-yl]phenoxy]phenyl]pyrrole-2,5-dione is 729.2ºC at 760 mmHg. |
| Q: What is the polar surface area (PSA) of 1-[4-[4-[2-[4-[4-(2,5-dioxopyrrol-1-yl)phenoxy]phenyl]propan-2-yl]phenoxy]phenyl]pyrrole-2,5-dione? |
| A: Polar surface area (PSA) of 1-[4-[4-[2-[4-[4-(2,5-dioxopyrrol-1-yl)phenoxy]phenyl]propan-2-yl]phenoxy]phenyl]pyrrole-2,5-dione is 93.22000. |
| Q: What is the molecular weight of 1-[4-[4-[2-[4-[4-(2,5-dioxopyrrol-1-yl)phenoxy]phenyl]propan-2-yl]phenoxy]phenyl]pyrrole-2,5-dione? |
| A: Molecular weight of 1-[4-[4-[2-[4-[4-(2,5-dioxopyrrol-1-yl)phenoxy]phenyl]propan-2-yl]phenoxy]phenyl]pyrrole-2,5-dione is 570.59100. |
| Q: What is the melting point of 1-[4-[4-[2-[4-[4-(2,5-dioxopyrrol-1-yl)phenoxy]phenyl]propan-2-yl]phenoxy]phenyl]pyrrole-2,5-dione? |
| A: Melting point of 1-[4-[4-[2-[4-[4-(2,5-dioxopyrrol-1-yl)phenoxy]phenyl]propan-2-yl]phenoxy]phenyl]pyrrole-2,5-dione is 165° C. |
| Q: What is the molecular formula of 1-[4-[4-[2-[4-[4-(2,5-dioxopyrrol-1-yl)phenoxy]phenyl]propan-2-yl]phenoxy]phenyl]pyrrole-2,5-dione? |
| A: Molecular formula of 1-[4-[4-[2-[4-[4-(2,5-dioxopyrrol-1-yl)phenoxy]phenyl]propan-2-yl]phenoxy]phenyl]pyrrole-2,5-dione is C35H26N2O6. |
| Q: What is the SMILES notation of 1-[4-[4-[2-[4-[4-(2,5-dioxopyrrol-1-yl)phenoxy]phenyl]propan-2-yl]phenoxy]phenyl]pyrrole-2,5-dione? |
| A: SMILES notation of 1-[4-[4-[2-[4-[4-(2,5-dioxopyrrol-1-yl)phenoxy]phenyl]propan-2-yl]phenoxy]phenyl]pyrrole-2,5-dione is CC(C)(c1ccc(Oc2ccc(N3C(=O)C=CC3=O)cc2)cc1)c1ccc(Oc2ccc(N3C(=O)C=CC3=O)cc2)cc1. |
| Q: What is the English name of 1-[4-[4-[2-[4-[4-(2,5-dioxopyrrol-1-yl)phenoxy]phenyl]propan-2-yl]phenoxy]phenyl]pyrrole-2,5-dione? |
| A: The English name of 1-[4-[4-[2-[4-[4-(2,5-dioxopyrrol-1-yl)phenoxy]phenyl]propan-2-yl]phenoxy]phenyl]pyrrole-2,5-dione is 1-[4-[4-[2-[4-[4-(2,5-dioxopyrrol-1-yl)phenoxy]phenyl]propan-2-yl]phenoxy]phenyl]pyrrole-2,5-dione. |
| Q: What is the LogP of 1-[4-[4-[2-[4-[4-(2,5-dioxopyrrol-1-yl)phenoxy]phenyl]propan-2-yl]phenoxy]phenyl]pyrrole-2,5-dione? |
| A: LogP of 1-[4-[4-[2-[4-[4-(2,5-dioxopyrrol-1-yl)phenoxy]phenyl]propan-2-yl]phenoxy]phenyl]pyrrole-2,5-dione is 6.58590. |
| Q: What is the InChIKey of 1-[4-[4-[2-[4-[4-(2,5-dioxopyrrol-1-yl)phenoxy]phenyl]propan-2-yl]phenoxy]phenyl]pyrrole-2,5-dione? |
| A: InChIKey of 1-[4-[4-[2-[4-[4-(2,5-dioxopyrrol-1-yl)phenoxy]phenyl]propan-2-yl]phenoxy]phenyl]pyrrole-2,5-dione is XAZPKEBWNIUCKF-UHFFFAOYSA-N. |
This table lists manufacturers and suppliers of this compound, including vendor names and product supply reference information.
| Shanghai Nianxing Industrial Co., Ltd |
| Henan Tianfu Chemical Co., Ltd. |