3-bromo-7-(3,4,5-trimethoxyphenyl)thieno[3,2-c]pyridin-4-amine
![3-bromo-7-(3,4,5-trimethoxyphenyl)thieno[3,2-c]pyridin-4-amine Structure](https://image.chemsrc.com/caspic/412/799293-92-8.png)
3-bromo-7-(3,4,5-trimethoxyphenyl)thieno[3,2-c]pyridin-4-amine structure
|
Common Name | 3-bromo-7-(3,4,5-trimethoxyphenyl)thieno[3,2-c]pyridin-4-amine | ||
|---|---|---|---|---|
| CAS Number | 799293-92-8 | Molecular Weight | 395.27100 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C16H15BrN2O3S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 3-bromo-7-(3,4,5-trimethoxyphenyl)thieno[3,2-c]pyridin-4-amine |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C16H15BrN2O3S |
|---|---|
| Molecular Weight | 395.27100 |
| Exact Mass | 393.99900 |
| PSA | 95.57000 |
| LogP | 4.26390 |
| InChIKey | TWLCHRPTWCVAEB-UHFFFAOYSA-N |
| SMILES | COc1cc(-c2cnc(N)c3c(Br)csc23)cc(OC)c1OC |
This table presents publicly reported synthetic routes, reaction conditions, reactants and product information of the compound.
![3-bromo-7-iodo-Thieno[3,2-c]pyridin-4-amine structure](https://image.chemsrc.com/caspic/450/799293-91-7.png)
![3-Bromothieno[3,2-c]pyridin-4(5H)-one structure](https://image.chemsrc.com/caspic/081/799293-83-7.png)
![3-bromo-7-iodothieno[3,2-c]pyridin-4(5H)-one structure](https://image.chemsrc.com/caspic/381/799293-88-2.png)
![3-bromo-4-chloro-7-iodothieno[3,2-c]pyridine structure](https://image.chemsrc.com/caspic/343/799293-89-3.png)
This table lists upstream starting materials and downstream derivative products related to this chemical.
| Precursor 6 | |
|---|---|
| DownStream 0 | |
This table contains target information, in‑vitro & in‑vivo assay data for this compound.
|
Name: Inhibition of human EphB4 by scintillation proximity method
Source: ChEMBL
Target: Ephrin type-B receptor 4
External Id: CHEMBL902105
|
This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| Thieno[3,2-c]pyridin-4-amine,3-bromo-7-(3,4,5-trimethoxyphenyl) |
| 4-amino-3-bromo-7-(3,4,5-trimethoxyphenyl)thieno[3,2-c]pyridine |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the English name of 3-bromo-7-(3,4,5-trimethoxyphenyl)thieno[3,2-c]pyridin-4-amine? |
| A: The English name of 3-bromo-7-(3,4,5-trimethoxyphenyl)thieno[3,2-c]pyridin-4-amine is 3-bromo-7-(3,4,5-trimethoxyphenyl)thieno[3,2-c]pyridin-4-amine. |
| Q: What is the SMILES notation of 3-bromo-7-(3,4,5-trimethoxyphenyl)thieno[3,2-c]pyridin-4-amine? |
| A: SMILES notation of 3-bromo-7-(3,4,5-trimethoxyphenyl)thieno[3,2-c]pyridin-4-amine is COc1cc(-c2cnc(N)c3c(Br)csc23)cc(OC)c1OC. |
| Q: What is the InChIKey of 3-bromo-7-(3,4,5-trimethoxyphenyl)thieno[3,2-c]pyridin-4-amine? |
| A: InChIKey of 3-bromo-7-(3,4,5-trimethoxyphenyl)thieno[3,2-c]pyridin-4-amine is TWLCHRPTWCVAEB-UHFFFAOYSA-N. |
| Q: What is the molecular formula of 3-bromo-7-(3,4,5-trimethoxyphenyl)thieno[3,2-c]pyridin-4-amine? |
| A: Molecular formula of 3-bromo-7-(3,4,5-trimethoxyphenyl)thieno[3,2-c]pyridin-4-amine is C16H15BrN2O3S. |
| Q: What are the upstream materials of 3-bromo-7-(3,4,5-trimethoxyphenyl)thieno[3,2-c]pyridin-4-amine? |
| A: Related upstream materials(CAS) of 3-bromo-7-(3,4,5-trimethoxyphenyl)thieno[3,2-c]pyridin-4-amine: 799293-91-7;182163-96-8;799293-83-7;799293-88-2;18791-75-8;103686-16-4. |
| Q: What is the CAS number of 3-bromo-7-(3,4,5-trimethoxyphenyl)thieno[3,2-c]pyridin-4-amine? |
| A: CAS number of 3-bromo-7-(3,4,5-trimethoxyphenyl)thieno[3,2-c]pyridin-4-amine is 799293-92-8. |
| Q: What English synonyms does 3-bromo-7-(3,4,5-trimethoxyphenyl)thieno[3,2-c]pyridin-4-amine have? |
| A: English synonyms of 3-bromo-7-(3,4,5-trimethoxyphenyl)thieno[3,2-c]pyridin-4-amine: Thieno[3,2-c]pyridin-4-amine,3-bromo-7-(3,4,5-trimethoxyphenyl), 4-amino-3-bromo-7-(3,4,5-trimethoxyphenyl)thieno[3,2-c]pyridine. |
| Q: What is the polar surface area (PSA) of 3-bromo-7-(3,4,5-trimethoxyphenyl)thieno[3,2-c]pyridin-4-amine? |
| A: Polar surface area (PSA) of 3-bromo-7-(3,4,5-trimethoxyphenyl)thieno[3,2-c]pyridin-4-amine is 95.57000. |
| Q: What is the molecular weight of 3-bromo-7-(3,4,5-trimethoxyphenyl)thieno[3,2-c]pyridin-4-amine? |
| A: Molecular weight of 3-bromo-7-(3,4,5-trimethoxyphenyl)thieno[3,2-c]pyridin-4-amine is 395.27100. |
| Q: What is the Chinese name of 799293-92-8? |
| A: Chinese name of 799293-92-8 is 799293-92-8. |