3-(2,4-dimethoxyphenyl)-3-phenyl-isobenzofuran-1-one structure
|
Common Name | 3-(2,4-dimethoxyphenyl)-3-phenyl-isobenzofuran-1-one | ||
|---|---|---|---|---|
| CAS Number | 79930-53-3 | Molecular Weight | 346.37600 | |
| Density | 1.233g/cm3 | Boiling Point | 524.7ºC at 760 mmHg | |
| Molecular Formula | C22H18O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 231ºC | |
| Name | 3-(2,4-dimethoxyphenyl)-3-phenyl-2-benzofuran-1-one |
|---|
| Density | 1.233g/cm3 |
|---|---|
| Boiling Point | 524.7ºC at 760 mmHg |
| Molecular Formula | C22H18O4 |
| Molecular Weight | 346.37600 |
| Flash Point | 231ºC |
| Exact Mass | 346.12100 |
| PSA | 44.76000 |
| LogP | 4.16610 |
| Index of Refraction | 1.612 |
| InChIKey | MKEWHFHXNVMHES-UHFFFAOYSA-N |
| SMILES | COc1ccc(C2(c3ccccc3)OC(=O)c3ccccc32)c(OC)c1 |
|
~80%
3-(2,4-dimethox... CAS#:79930-53-3 |
| Literature: Canevet, Jean-Claude; Guilloton, Odette Bulletin de la Societe Chimique de France, 1981 , vol. 2, # 3-4 p. 96 - 98 |
|
~%
3-(2,4-dimethox... CAS#:79930-53-3 |
| Literature: Hubacher Journal of Organic Chemistry, 1958 , vol. 23, p. 1400 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |