9-[(2R,3R,4S,5R)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-2-[(E)-(4-nitroanilino)diazenyl]-3H-purin-6-one structure
|
Common Name | 9-[(2R,3R,4S,5R)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-2-[(E)-(4-nitroanilino)diazenyl]-3H-purin-6-one | ||
|---|---|---|---|---|
| CAS Number | 79953-11-0 | Molecular Weight | 432.34800 | |
| Density | 2g/cm3 | Boiling Point | 827.9ºC at 760 mmHg | |
| Molecular Formula | C16H16N8O7 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 454.5ºC | |
| Name | 9-[(2R,3R,4S,5R)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-2-[(E)-(4-nitroanilino)diazenyl]-3H-purin-6-one |
|---|
| Density | 2g/cm3 |
|---|---|
| Boiling Point | 827.9ºC at 760 mmHg |
| Molecular Formula | C16H16N8O7 |
| Molecular Weight | 432.34800 |
| Flash Point | 454.5ºC |
| Exact Mass | 432.11400 |
| PSA | 216.32000 |
| LogP | 0.75860 |
| Index of Refraction | 1.879 |
| InChIKey | ZDODGEAVXVIPBZ-SDBHATRESA-N |
| SMILES | O=c1[nH]c(N=NNc2ccc([N+](=O)[O-])cc2)nc2c1ncn2C1OC(CO)C(O)C1O |
|
~%
9-[(2R,3R,4S,5R... CAS#:79953-11-0 |
| Literature: Hung, Ming-Hong; Stock, Leon M. Journal of Organic Chemistry, 1982 , vol. 47, # 3 p. 448 - 453 |