Benzenesulfonamide,N-(3-nitrophenyl) structure
|
Common Name | Benzenesulfonamide,N-(3-nitrophenyl) | ||
|---|---|---|---|---|
| CAS Number | 80-37-5 | Molecular Weight | 278.28400 | |
| Density | 1.461g/cm3 | Boiling Point | 443.2ºC at 760 mmHg | |
| Molecular Formula | C12H10N2O4S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 221.8ºC | |
| Name | N-(3-nitrophenyl)benzenesulfonamide |
|---|---|
| Synonym | More Synonyms |
| Density | 1.461g/cm3 |
|---|---|
| Boiling Point | 443.2ºC at 760 mmHg |
| Molecular Formula | C12H10N2O4S |
| Molecular Weight | 278.28400 |
| Flash Point | 221.8ºC |
| Exact Mass | 278.03600 |
| PSA | 100.37000 |
| LogP | 4.07260 |
| Index of Refraction | 1.656 |
| InChIKey | CWBLFCFUSMBFSO-UHFFFAOYSA-N |
| SMILES | O=[N+]([O-])c1cccc(NS(=O)(=O)c2ccccc2)c1 |
|
Name: Protonation constant (Proton-ligand formation constant) was determined
Source: ChEMBL
Target: N/A
External Id: CHEMBL839087
|
|
Name: Cell-based high throughput primary assay to identify activators of GPR151
Source: The Scripps Research Institute Molecular Screening Center
Target: RecName: Full=G-protein coupled receptor 151; AltName: Full=G-protein coupled receptor PGR7; AltName: Full=GPCR-2037; AltName: Full=Galanin receptor 4; AltName: Full=Galanin-receptor-like protein; Short=GalRL
External Id: GPR151_PHUNTER_AG_LUMI_1536_1X%ACT
|
|
Name: AlphaScreen-based biochemical high throughput primary assay to identify activators of...
Source: The Scripps Research Institute Molecular Screening Center
Target: N/A
External Id: FBW7_ACT_ALPHA_1536_1X%ACT PRUN
|
|
Name: AlphaScreen-based biochemical high throughput primary assay to identify inhibitors of...
Source: The Scripps Research Institute Molecular Screening Center
External Id: MITF_INH_Alpha_1536_1X%INH PRUN
|
| Benzolsulfonsaeure-<3-nitro-anilid> |
| Benzenesulfonanilide,3'-nitro |