Estra-1,3,5(10)-trien-17-one,3-(3-hydroxypropoxy)-4-nitro- (9CI) structure
|
Common Name | Estra-1,3,5(10)-trien-17-one,3-(3-hydroxypropoxy)-4-nitro- (9CI) | ||
|---|---|---|---|---|
| CAS Number | 80082-67-3 | Molecular Weight | 373.44300 | |
| Density | 1.244g/cm3 | Boiling Point | 554.1ºC at 760mmHg | |
| Molecular Formula | C21H27NO5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 288.9ºC | |
| Name | (8R,9S,13S,14S)-3-(3-hydroxypropoxy)-13-methyl-4-nitro-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-17-one |
|---|
| Density | 1.244g/cm3 |
|---|---|
| Boiling Point | 554.1ºC at 760mmHg |
| Molecular Formula | C21H27NO5 |
| Molecular Weight | 373.44300 |
| Flash Point | 288.9ºC |
| Exact Mass | 373.18900 |
| PSA | 92.35000 |
| LogP | 4.30440 |
| Index of Refraction | 1.582 |
| InChIKey | UROCJSOQPSTRCB-WYSJICDVSA-N |
| SMILES | CC12CCC3c4ccc(OCCCO)c([N+](=O)[O-])c4CCC3C1CCC2=O |
|
~60%
Estra-1,3,5(10)... CAS#:80082-67-3 |
| Literature: Iyer, Vaidyanathan K.; Horwitz, Jerome P. Journal of Organic Chemistry, 1982 , vol. 47, # 4 p. 644 - 649 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |